About N,N'-dicyclohexylmethanediimine;urea
N,N'-dicyclohexylmethanediimine;urea (PubChem CID 86734857) has the molecular formula C14H26N4O
and a molecular weight of 266.39 g/mol. Its IUPAC name is N,N'-dicyclohexylmethanediimine;urea.
Molecular Properties
| Compound Name | N,N'-dicyclohexylmethanediimine;urea |
| PubChem CID | 86734857 |
| Molecular Formula | C14H26N4O |
| Molecular Weight | 266.39 g/mol |
| Exact Mass | 266.21 |
| IUPAC Name | N,N'-dicyclohexylmethanediimine;urea |
| SMILES | C(=NC1CCCCC1)=NC1CCCCC1.NC(N)=O |
| InChI | InChI=1S/C13H22N2.CH4N2O/c1-3-7-12(8-4-1)14-11-15-13-9-5-2-6-10-13;2-1(3)4/h12-13H,1-10H2;(H4,2,3,4) |
| InChIKey | RKLYEKUBLQQQAL-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 93.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.39 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N,N'-dicyclohexylmethanediimine;urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N'-dicyclohexylmethanediimine;urea?
The IUPAC name of N,N'-dicyclohexylmethanediimine;urea (CID 86734857) is N,N'-dicyclohexylmethanediimine;urea.
What is the SMILES notation for N,N'-dicyclohexylmethanediimine;urea?
The canonical SMILES for N,N'-dicyclohexylmethanediimine;urea is C(=NC1CCCCC1)=NC1CCCCC1.NC(N)=O.
What is the InChIKey of N,N'-dicyclohexylmethanediimine;urea?
The InChIKey is RKLYEKUBLQQQAL-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22N2.CH4N2O/c1-3-7-12(8-4-1)14-11-15-13-9-5-2-6-10-13;2-1(3)4/h12-13H,1-10H2;(H4,2,3,4).
What are the key properties of N,N'-dicyclohexylmethanediimine;urea?
N,N'-dicyclohexylmethanediimine;urea has a molecular weight of 266.39 g/mol, XLogP of 2.85, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N,N'-dicyclohexylmethanediimine;urea is sourced from PubChem (CID 86734857), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).