C10H9F3O — CID 86735270
2-(4,4,4-trifluorobut-2-enyl)-7-oxabicyclo[4.1.0]hepta-2,4-diene (PubChem CID 86735270) has the molecular formula C10H9F3O and a molecular weight of 202.17 g/mol. Its IUPAC name is 2-(4,4,4-trifluorobut-2-enyl)-7-oxabicyclo[4.1.0]hepta-2,4-diene.
| Compound Name | 2-(4,4,4-trifluorobut-2-enyl)-7-oxabicyclo[4.1.0]hepta-2,4-diene |
|---|---|
| PubChem CID | 86735270 |
| Molecular Formula | C10H9F3O |
| Molecular Weight | 202.17 g/mol |
| Exact Mass | 202.06 |
| IUPAC Name | 2-(4,4,4-trifluorobut-2-enyl)-7-oxabicyclo[4.1.0]hepta-2,4-diene |
| SMILES | FC(F)(F)C=CCC1=CC=CC2OC12 |
| InChI | InChI=1S/C10H9F3O/c11-10(12,13)6-2-4-7-3-1-5-8-9(7)14-8/h1-3,5-6,8-9H,4H2 |
| InChIKey | IKGDAIKRTYQLIA-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.17 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|