About 1-benzyl-4-methylpiperidine-2-carboxylic acid;4-methylbenzenesulfonic acid
1-benzyl-4-methylpiperidine-2-carboxylic acid;4-methylbenzenesulfonic acid (PubChem CID 86735354) has the molecular formula C21H27NO5S
and a molecular weight of 405.52 g/mol. Its IUPAC name is 1-benzyl-4-methylpiperidine-2-carboxylic acid;4-methylbenzenesulfonic acid.
Molecular Properties
| Compound Name | 1-benzyl-4-methylpiperidine-2-carboxylic acid;4-methylbenzenesulfonic acid |
| PubChem CID | 86735354 |
| Molecular Formula | C21H27NO5S |
| Molecular Weight | 405.52 g/mol |
| Exact Mass | 405.16 |
| IUPAC Name | 1-benzyl-4-methylpiperidine-2-carboxylic acid;4-methylbenzenesulfonic acid |
| SMILES | CC1CCN(Cc2ccccc2)C(C(=O)O)C1.Cc1ccc(S(=O)(=O)O)cc1 |
| InChI | InChI=1S/C14H19NO2.C7H8O3S/c1-11-7-8-15(13(9-11)14(16)17)10-12-5-3-2-4-6-12;1-6-2-4-7(5-3-6)11(8,9)10/h2-6,11,13H,7-10H2,1H3,(H,16,17);2-5H,1H3,(H,8,9,10) |
| InChIKey | QTEWSINTOHHHAO-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 94.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 405.52 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 1-benzyl-4-methylpiperidine-2-carboxylic acid;4-methylbenzenesulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzyl-4-methylpiperidine-2-carboxylic acid;4-methylbenzenesulfonic acid?
The IUPAC name of 1-benzyl-4-methylpiperidine-2-carboxylic acid;4-methylbenzenesulfonic acid (CID 86735354) is 1-benzyl-4-methylpiperidine-2-carboxylic acid;4-methylbenzenesulfonic acid.
What is the SMILES notation for 1-benzyl-4-methylpiperidine-2-carboxylic acid;4-methylbenzenesulfonic acid?
The canonical SMILES for 1-benzyl-4-methylpiperidine-2-carboxylic acid;4-methylbenzenesulfonic acid is CC1CCN(Cc2ccccc2)C(C(=O)O)C1.Cc1ccc(S(=O)(=O)O)cc1.
What is the InChIKey of 1-benzyl-4-methylpiperidine-2-carboxylic acid;4-methylbenzenesulfonic acid?
The InChIKey is QTEWSINTOHHHAO-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19NO2.C7H8O3S/c1-11-7-8-15(13(9-11)14(16)17)10-12-5-3-2-4-6-12;1-6-2-4-7(5-3-6)11(8,9)10/h2-6,11,13H,7-10H2,1H3,(H,16,17);2-5H,1H3,(H,8,9,10).
What are the key properties of 1-benzyl-4-methylpiperidine-2-carboxylic acid;4-methylbenzenesulfonic acid?
1-benzyl-4-methylpiperidine-2-carboxylic acid;4-methylbenzenesulfonic acid has a molecular weight of 405.52 g/mol, XLogP of 3.61, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzyl-4-methylpiperidine-2-carboxylic acid;4-methylbenzenesulfonic acid is sourced from PubChem (CID 86735354), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).