About 7-methoxy-2,2-dimethyl-4-[4-(trifluoromethyl)phenyl]-3,4-dihydro-1H-quinoline
7-methoxy-2,2-dimethyl-4-[4-(trifluoromethyl)phenyl]-3,4-dihydro-1H-quinoline (PubChem CID 86735786) has the molecular formula C19H20F3NO
and a molecular weight of 335.37 g/mol. Its IUPAC name is 7-methoxy-2,2-dimethyl-4-[4-(trifluoromethyl)phenyl]-3,4-dihydro-1H-quinoline.
Molecular Properties
| Compound Name | 7-methoxy-2,2-dimethyl-4-[4-(trifluoromethyl)phenyl]-3,4-dihydro-1H-quinoline |
| PubChem CID | 86735786 |
| Molecular Formula | C19H20F3NO |
| Molecular Weight | 335.37 g/mol |
| Exact Mass | 335.15 |
| IUPAC Name | 7-methoxy-2,2-dimethyl-4-[4-(trifluoromethyl)phenyl]-3,4-dihydro-1H-quinoline |
| SMILES | COc1ccc2c(c1)NC(C)(C)CC2c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C19H20F3NO/c1-18(2)11-16(12-4-6-13(7-5-12)19(20,21)22)15-9-8-14(24-3)10-17(15)23-18/h4-10,16,23H,11H2,1-3H3 |
| InChIKey | BFFBKPJEPPXUGA-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 335.37 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 7-methoxy-2,2-dimethyl-4-[4-(trifluoromethyl)phenyl]-3,4-dihydro-1H-quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-methoxy-2,2-dimethyl-4-[4-(trifluoromethyl)phenyl]-3,4-dihydro-1H-quinoline?
The IUPAC name of 7-methoxy-2,2-dimethyl-4-[4-(trifluoromethyl)phenyl]-3,4-dihydro-1H-quinoline (CID 86735786) is 7-methoxy-2,2-dimethyl-4-[4-(trifluoromethyl)phenyl]-3,4-dihydro-1H-quinoline.
What is the SMILES notation for 7-methoxy-2,2-dimethyl-4-[4-(trifluoromethyl)phenyl]-3,4-dihydro-1H-quinoline?
The canonical SMILES for 7-methoxy-2,2-dimethyl-4-[4-(trifluoromethyl)phenyl]-3,4-dihydro-1H-quinoline is COc1ccc2c(c1)NC(C)(C)CC2c1ccc(C(F)(F)F)cc1.
What is the InChIKey of 7-methoxy-2,2-dimethyl-4-[4-(trifluoromethyl)phenyl]-3,4-dihydro-1H-quinoline?
The InChIKey is BFFBKPJEPPXUGA-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H20F3NO/c1-18(2)11-16(12-4-6-13(7-5-12)19(20,21)22)15-9-8-14(24-3)10-17(15)23-18/h4-10,16,23H,11H2,1-3H3.
What are the key properties of 7-methoxy-2,2-dimethyl-4-[4-(trifluoromethyl)phenyl]-3,4-dihydro-1H-quinoline?
7-methoxy-2,2-dimethyl-4-[4-(trifluoromethyl)phenyl]-3,4-dihydro-1H-quinoline has a molecular weight of 335.37 g/mol, XLogP of 5.44, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-methoxy-2,2-dimethyl-4-[4-(trifluoromethyl)phenyl]-3,4-dihydro-1H-quinoline is sourced from PubChem (CID 86735786), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).