C26H42O4 — CID 86735944
(E)-6-[(3R,5R,8R,9S,10S,12S,13R,14S,17R)-3,12-dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]hept-2-enoic acid (PubChem CID 86735944) has the molecular formula C26H42O4 and a molecular weight of 418.62 g/mol. Its IUPAC name is (E)-6-[(3R,5R,8R,9S,10S,12S,13R,14S,17R)-3,12-dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]hept-2-enoic acid.
| Compound Name | (E)-6-[(3R,5R,8R,9S,10S,12S,13R,14S,17R)-3,12-dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]hept-2-enoic acid |
|---|---|
| PubChem CID | 86735944 |
| Molecular Formula | C26H42O4 |
| Molecular Weight | 418.62 g/mol |
| Exact Mass | 418.31 |
| IUPAC Name | (E)-6-[(3R,5R,8R,9S,10S,12S,13R,14S,17R)-3,12-dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]hept-2-enoic acid |
| SMILES | CC(CC/C=C/C(=O)O)[C@H]1CC[C@H]2[C@@H]3CC[C@@H]4C[C@H](O)CC[C@]4(C)[C@H]3C[C@H](O)[C@]12C |
| InChI | InChI=1S/C26H42O4/c1-16(6-4-5-7-24(29)30)20-10-11-21-19-9-8-17-14-18(27)12-13-25(17,2)22(19)15-23(28)26(20,21)3/h5,7,16-23,27-28H,4,6,8-15H2,1-3H3,(H,29,30)/b7-5+/t16?,17-,18-,19+,20-,21+,22+,23+,25+,26-/m1/s1 |
| InChIKey | XLWGIYXRCKQTBL-DFYNDQAUSA-N |
| XLogP | 5.03 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.62 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|