C15H23F3N2O6S — CID 86736007
(2S)-1-[2-(acetylsulfanylmethyl)-5-aminopentanoyl]pyrrolidine-2-carboxylic acid;2,2,2-trifluoroacetic acid (PubChem CID 86736007) has the molecular formula C15H23F3N2O6S and a molecular weight of 416.42 g/mol. Its IUPAC name is (2S)-1-[2-(acetylsulfanylmethyl)-5-aminopentanoyl]pyrrolidine-2-carboxylic acid;2,2,2-trifluoroacetic acid.
| Compound Name | (2S)-1-[2-(acetylsulfanylmethyl)-5-aminopentanoyl]pyrrolidine-2-carboxylic acid;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 86736007 |
| Molecular Formula | C15H23F3N2O6S |
| Molecular Weight | 416.42 g/mol |
| Exact Mass | 416.12 |
| IUPAC Name | (2S)-1-[2-(acetylsulfanylmethyl)-5-aminopentanoyl]pyrrolidine-2-carboxylic acid;2,2,2-trifluoroacetic acid |
| SMILES | CC(=O)SCC(CCCN)C(=O)N1CCC[C@H]1C(=O)O.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C13H22N2O4S.C2HF3O2/c1-9(16)20-8-10(4-2-6-14)12(17)15-7-3-5-11(15)13(18)19;3-2(4,5)1(6)7/h10-11H,2-8,14H2,1H3,(H,18,19);(H,6,7)/t10?,11-;/m0./s1 |
| InChIKey | OVZMVFQAUBBYCW-GQNCZFCYSA-N |
| XLogP | 1.33 |
| TPSA | 138.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.42 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|