C14H18ClNO — CID 86736139
4-(4-chlorophenyl)-1,2,3,3a,5,6,7,7a-octahydroindol-4-ol (PubChem CID 86736139) has the molecular formula C14H18ClNO and a molecular weight of 251.76 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-1,2,3,3a,5,6,7,7a-octahydroindol-4-ol.
| Compound Name | 4-(4-chlorophenyl)-1,2,3,3a,5,6,7,7a-octahydroindol-4-ol |
|---|---|
| PubChem CID | 86736139 |
| Molecular Formula | C14H18ClNO |
| Molecular Weight | 251.76 g/mol |
| Exact Mass | 251.11 |
| IUPAC Name | 4-(4-chlorophenyl)-1,2,3,3a,5,6,7,7a-octahydroindol-4-ol |
| SMILES | OC1(c2ccc(Cl)cc2)CCCC2NCCC21 |
| InChI | InChI=1S/C14H18ClNO/c15-11-5-3-10(4-6-11)14(17)8-1-2-13-12(14)7-9-16-13/h3-6,12-13,16-17H,1-2,7-9H2 |
| InChIKey | VLLZJYVDYDUFRT-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.76 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |