About (Z,3S)-1-chloro-3,7-dimethyloct-4-ene
(Z,3S)-1-chloro-3,7-dimethyloct-4-ene (PubChem CID 86736281) has the molecular formula C10H19Cl
and a molecular weight of 174.71 g/mol. Its IUPAC name is (Z,3S)-1-chloro-3,7-dimethyloct-4-ene.
Molecular Properties
| Compound Name | (Z,3S)-1-chloro-3,7-dimethyloct-4-ene |
| PubChem CID | 86736281 |
| Molecular Formula | C10H19Cl |
| Molecular Weight | 174.71 g/mol |
| Exact Mass | 174.12 |
| IUPAC Name | (Z,3S)-1-chloro-3,7-dimethyloct-4-ene |
| SMILES | CC(C)C/C=C\[C@@H](C)CCCl |
| InChI | InChI=1S/C10H19Cl/c1-9(2)5-4-6-10(3)7-8-11/h4,6,9-10H,5,7-8H2,1-3H3/b6-4-/t10-/m1/s1 |
| InChIKey | QTQMBIPZPBQPKD-AYYIZTPMSA-N |
| XLogP | 3.85 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.71 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (Z,3S)-1-chloro-3,7-dimethyloct-4-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z,3S)-1-chloro-3,7-dimethyloct-4-ene?
The IUPAC name of (Z,3S)-1-chloro-3,7-dimethyloct-4-ene (CID 86736281) is (Z,3S)-1-chloro-3,7-dimethyloct-4-ene.
What is the SMILES notation for (Z,3S)-1-chloro-3,7-dimethyloct-4-ene?
The canonical SMILES for (Z,3S)-1-chloro-3,7-dimethyloct-4-ene is CC(C)C/C=C\[C@@H](C)CCCl.
What is the InChIKey of (Z,3S)-1-chloro-3,7-dimethyloct-4-ene?
The InChIKey is QTQMBIPZPBQPKD-AYYIZTPMSA-N. The full InChI is InChI=1S/C10H19Cl/c1-9(2)5-4-6-10(3)7-8-11/h4,6,9-10H,5,7-8H2,1-3H3/b6-4-/t10-/m1/s1.
What are the key properties of (Z,3S)-1-chloro-3,7-dimethyloct-4-ene?
(Z,3S)-1-chloro-3,7-dimethyloct-4-ene has a molecular weight of 174.71 g/mol, XLogP of 3.85, 5 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (Z,3S)-1-chloro-3,7-dimethyloct-4-ene is sourced from PubChem (CID 86736281), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).