C22H23NO5 — CID 86736416
(Z)-but-2-enedioic acid;(2R,7S)-4-methyl-14-oxa-4-azatetracyclo[13.4.0.02,7.08,13]nonadeca-1(19),8,10,12,15,17-hexaene (PubChem CID 86736416) has the molecular formula C22H23NO5 and a molecular weight of 381.43 g/mol. Its IUPAC name is (Z)-but-2-enedioic acid;(2R,7S)-4-methyl-14-oxa-4-azatetracyclo[13.4.0.02,7.08,13]nonadeca-1(19),8,10,12,15,17-hexaene.
| Compound Name | (Z)-but-2-enedioic acid;(2R,7S)-4-methyl-14-oxa-4-azatetracyclo[13.4.0.02,7.08,13]nonadeca-1(19),8,10,12,15,17-hexaene |
|---|---|
| PubChem CID | 86736416 |
| Molecular Formula | C22H23NO5 |
| Molecular Weight | 381.43 g/mol |
| Exact Mass | 381.16 |
| IUPAC Name | (Z)-but-2-enedioic acid;(2R,7S)-4-methyl-14-oxa-4-azatetracyclo[13.4.0.02,7.08,13]nonadeca-1(19),8,10,12,15,17-hexaene |
| SMILES | CN1CC[C@@H]2c3ccccc3Oc3ccccc3[C@@H]2C1.O=C(O)/C=C\C(=O)O |
| InChI | InChI=1S/C18H19NO.C4H4O4/c1-19-11-10-13-14-6-2-4-8-17(14)20-18-9-5-3-7-15(18)16(13)12-19;5-3(6)1-2-4(7)8/h2-9,13,16H,10-12H2,1H3;1-2H,(H,5,6)(H,7,8)/b;2-1-/t13-,16-;/m1./s1 |
| InChIKey | XWCFZNRQJARLBA-LRRWJNHTSA-N |
| XLogP | 3.71 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.43 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|