C20H33N5O5S — CID 86736833
4-[5-(butylcarbamoylamino)-3-oxo-1H-pyrazol-2-yl]benzenesulfonic acid;N,N-diethylethanamine (PubChem CID 86736833) has the molecular formula C20H33N5O5S and a molecular weight of 455.58 g/mol. Its IUPAC name is 4-[5-(butylcarbamoylamino)-3-oxo-1H-pyrazol-2-yl]benzenesulfonic acid;N,N-diethylethanamine.
| Compound Name | 4-[5-(butylcarbamoylamino)-3-oxo-1H-pyrazol-2-yl]benzenesulfonic acid;N,N-diethylethanamine |
|---|---|
| PubChem CID | 86736833 |
| Molecular Formula | C20H33N5O5S |
| Molecular Weight | 455.58 g/mol |
| Exact Mass | 455.22 |
| IUPAC Name | 4-[5-(butylcarbamoylamino)-3-oxo-1H-pyrazol-2-yl]benzenesulfonic acid;N,N-diethylethanamine |
| SMILES | CCCCNC(=O)Nc1cc(=O)n(-c2ccc(S(=O)(=O)O)cc2)[nH]1.CCN(CC)CC |
| InChI | InChI=1S/C14H18N4O5S.C6H15N/c1-2-3-8-15-14(20)16-12-9-13(19)18(17-12)10-4-6-11(7-5-10)24(21,22)23;1-4-7(5-2)6-3/h4-7,9,17H,2-3,8H2,1H3,(H2,15,16,20)(H,21,22,23);4-6H2,1-3H3 |
| InChIKey | MGXZYRRBKVINMY-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 136.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.58 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|