About 2-fluoro-2-nitropropane-1,3-diol;trifluoromethanesulfonic acid
2-fluoro-2-nitropropane-1,3-diol;trifluoromethanesulfonic acid (PubChem CID 86737245) has the molecular formula C4H7F4NO7S
and a molecular weight of 289.16 g/mol. Its IUPAC name is 2-fluoro-2-nitropropane-1,3-diol;trifluoromethanesulfonic acid.
Molecular Properties
| Compound Name | 2-fluoro-2-nitropropane-1,3-diol;trifluoromethanesulfonic acid |
| PubChem CID | 86737245 |
| Molecular Formula | C4H7F4NO7S |
| Molecular Weight | 289.16 g/mol |
| Exact Mass | 288.99 |
| IUPAC Name | 2-fluoro-2-nitropropane-1,3-diol;trifluoromethanesulfonic acid |
| SMILES | O=S(=O)(O)C(F)(F)F.O=[N+]([O-])C(F)(CO)CO |
| InChI | InChI=1S/C3H6FNO4.CHF3O3S/c4-3(1-6,2-7)5(8)9;2-1(3,4)8(5,6)7/h6-7H,1-2H2;(H,5,6,7) |
| InChIKey | FBWZXEXBYFOGOV-UHFFFAOYSA-N |
| XLogP | -0.69 |
| TPSA | 137.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.16 |
| LogP ≤ 5 | -0.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze 2-fluoro-2-nitropropane-1,3-diol;trifluoromethanesulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluoro-2-nitropropane-1,3-diol;trifluoromethanesulfonic acid?
The IUPAC name of 2-fluoro-2-nitropropane-1,3-diol;trifluoromethanesulfonic acid (CID 86737245) is 2-fluoro-2-nitropropane-1,3-diol;trifluoromethanesulfonic acid.
What is the SMILES notation for 2-fluoro-2-nitropropane-1,3-diol;trifluoromethanesulfonic acid?
The canonical SMILES for 2-fluoro-2-nitropropane-1,3-diol;trifluoromethanesulfonic acid is O=S(=O)(O)C(F)(F)F.O=[N+]([O-])C(F)(CO)CO.
What is the InChIKey of 2-fluoro-2-nitropropane-1,3-diol;trifluoromethanesulfonic acid?
The InChIKey is FBWZXEXBYFOGOV-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H6FNO4.CHF3O3S/c4-3(1-6,2-7)5(8)9;2-1(3,4)8(5,6)7/h6-7H,1-2H2;(H,5,6,7).
What are the key properties of 2-fluoro-2-nitropropane-1,3-diol;trifluoromethanesulfonic acid?
2-fluoro-2-nitropropane-1,3-diol;trifluoromethanesulfonic acid has a molecular weight of 289.16 g/mol, XLogP of -0.69, 3 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluoro-2-nitropropane-1,3-diol;trifluoromethanesulfonic acid is sourced from PubChem (CID 86737245), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).