C14H8N6O12 — CID 86737461
1,2,3,4,5-pentanitro-6-(1-nitro-2-phenylethyl)benzene (PubChem CID 86737461) has the molecular formula C14H8N6O12 and a molecular weight of 452.25 g/mol. Its IUPAC name is 1,2,3,4,5-pentanitro-6-(1-nitro-2-phenylethyl)benzene.
| Compound Name | 1,2,3,4,5-pentanitro-6-(1-nitro-2-phenylethyl)benzene |
|---|---|
| PubChem CID | 86737461 |
| Molecular Formula | C14H8N6O12 |
| Molecular Weight | 452.25 g/mol |
| Exact Mass | 452.02 |
| IUPAC Name | 1,2,3,4,5-pentanitro-6-(1-nitro-2-phenylethyl)benzene |
| SMILES | O=[N+]([O-])c1c(C(Cc2ccccc2)[N+](=O)[O-])c([N+](=O)[O-])c([N+](=O)[O-])c([N+](=O)[O-])c1[N+](=O)[O-] |
| InChI | InChI=1S/C14H8N6O12/c21-15(22)8(6-7-4-2-1-3-5-7)9-10(16(23)24)12(18(27)28)14(20(31)32)13(19(29)30)11(9)17(25)26/h1-5,8H,6H2 |
| InChIKey | ZASQDXIJRKCNQS-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 258.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.25 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|