About furan-2,5-dione;oct-1-ene
furan-2,5-dione;oct-1-ene (PubChem CID 86738184) has the molecular formula C12H18O3
and a molecular weight of 210.27 g/mol. Its IUPAC name is furan-2,5-dione;oct-1-ene.
Molecular Properties
| Compound Name | furan-2,5-dione;oct-1-ene |
| PubChem CID | 86738184 |
| Molecular Formula | C12H18O3 |
| Molecular Weight | 210.27 g/mol |
| Exact Mass | 210.13 |
| IUPAC Name | furan-2,5-dione;oct-1-ene |
| SMILES | C=CCCCCCC.O=C1C=CC(=O)O1 |
| InChI | InChI=1S/C8H16.C4H2O3/c1-3-5-7-8-6-4-2;5-3-1-2-4(6)7-3/h3H,1,4-8H2,2H3;1-2H |
| InChIKey | NKATYJVNTDFYDX-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.27 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze furan-2,5-dione;oct-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of furan-2,5-dione;oct-1-ene?
The IUPAC name of furan-2,5-dione;oct-1-ene (CID 86738184) is furan-2,5-dione;oct-1-ene.
What is the SMILES notation for furan-2,5-dione;oct-1-ene?
The canonical SMILES for furan-2,5-dione;oct-1-ene is C=CCCCCCC.O=C1C=CC(=O)O1.
What is the InChIKey of furan-2,5-dione;oct-1-ene?
The InChIKey is NKATYJVNTDFYDX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16.C4H2O3/c1-3-5-7-8-6-4-2;5-3-1-2-4(6)7-3/h3H,1,4-8H2,2H3;1-2H.
What are the key properties of furan-2,5-dione;oct-1-ene?
furan-2,5-dione;oct-1-ene has a molecular weight of 210.27 g/mol, XLogP of 2.77, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for furan-2,5-dione;oct-1-ene is sourced from PubChem (CID 86738184), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).