About [5-methoxy-6-methyl-6-(methylaminomethyl)cyclohexa-2,4-dien-1-yl]methanol
[5-methoxy-6-methyl-6-(methylaminomethyl)cyclohexa-2,4-dien-1-yl]methanol (PubChem CID 86738640) has the molecular formula C11H19NO2
and a molecular weight of 197.28 g/mol. Its IUPAC name is [5-methoxy-6-methyl-6-(methylaminomethyl)cyclohexa-2,4-dien-1-yl]methanol.
Molecular Properties
| Compound Name | [5-methoxy-6-methyl-6-(methylaminomethyl)cyclohexa-2,4-dien-1-yl]methanol |
| PubChem CID | 86738640 |
| Molecular Formula | C11H19NO2 |
| Molecular Weight | 197.28 g/mol |
| Exact Mass | 197.14 |
| IUPAC Name | [5-methoxy-6-methyl-6-(methylaminomethyl)cyclohexa-2,4-dien-1-yl]methanol |
| SMILES | CNCC1(C)C(OC)=CC=CC1CO |
| InChI | InChI=1S/C11H19NO2/c1-11(8-12-2)9(7-13)5-4-6-10(11)14-3/h4-6,9,12-13H,7-8H2,1-3H3 |
| InChIKey | LAPMKAVIPRBJHI-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.28 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [5-methoxy-6-methyl-6-(methylaminomethyl)cyclohexa-2,4-dien-1-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-methoxy-6-methyl-6-(methylaminomethyl)cyclohexa-2,4-dien-1-yl]methanol?
The IUPAC name of [5-methoxy-6-methyl-6-(methylaminomethyl)cyclohexa-2,4-dien-1-yl]methanol (CID 86738640) is [5-methoxy-6-methyl-6-(methylaminomethyl)cyclohexa-2,4-dien-1-yl]methanol.
What is the SMILES notation for [5-methoxy-6-methyl-6-(methylaminomethyl)cyclohexa-2,4-dien-1-yl]methanol?
The canonical SMILES for [5-methoxy-6-methyl-6-(methylaminomethyl)cyclohexa-2,4-dien-1-yl]methanol is CNCC1(C)C(OC)=CC=CC1CO.
What is the InChIKey of [5-methoxy-6-methyl-6-(methylaminomethyl)cyclohexa-2,4-dien-1-yl]methanol?
The InChIKey is LAPMKAVIPRBJHI-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19NO2/c1-11(8-12-2)9(7-13)5-4-6-10(11)14-3/h4-6,9,12-13H,7-8H2,1-3H3.
What are the key properties of [5-methoxy-6-methyl-6-(methylaminomethyl)cyclohexa-2,4-dien-1-yl]methanol?
[5-methoxy-6-methyl-6-(methylaminomethyl)cyclohexa-2,4-dien-1-yl]methanol has a molecular weight of 197.28 g/mol, XLogP of 0.92, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [5-methoxy-6-methyl-6-(methylaminomethyl)cyclohexa-2,4-dien-1-yl]methanol is sourced from PubChem (CID 86738640), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).