C21H26ClF3O2 — CID 86738808
trans-(2,6-dimethyl-3-propan-2-ylphenyl)methyl (1S,3S)-3-(2-chloro-3,3,3-trifluoroprop-1-enyl)-2,2-dimethylcyclopropane-1-carboxylate (PubChem CID 86738808) has the molecular formula C21H26ClF3O2 and a molecular weight of 402.88 g/mol. Its IUPAC name is trans-(2,6-dimethyl-3-propan-2-ylphenyl)methyl (1S,3S)-3-(2-chloro-3,3,3-trifluoroprop-1-enyl)-2,2-dimethylcyclopropane-1-carboxylate.
| Compound Name | trans-(2,6-dimethyl-3-propan-2-ylphenyl)methyl (1S,3S)-3-(2-chloro-3,3,3-trifluoroprop-1-enyl)-2,2-dimethylcyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 86738808 |
| Molecular Formula | C21H26ClF3O2 |
| Molecular Weight | 402.88 g/mol |
| Exact Mass | 402.16 |
| IUPAC Name | trans-(2,6-dimethyl-3-propan-2-ylphenyl)methyl (1S,3S)-3-(2-chloro-3,3,3-trifluoroprop-1-enyl)-2,2-dimethylcyclopropane-1-carboxylate |
| SMILES | Cc1ccc(C(C)C)c(C)c1COC(=O)[C@H]1[C@@H](C=C(Cl)C(F)(F)F)C1(C)C |
| InChI | InChI=1S/C21H26ClF3O2/c1-11(2)14-8-7-12(3)15(13(14)4)10-27-19(26)18-16(20(18,5)6)9-17(22)21(23,24)25/h7-9,11,16,18H,10H2,1-6H3/t16-,18-/m1/s1 |
| InChIKey | VSGAFFZSRWKROA-SJLPKXTDSA-N |
| XLogP | 6.43 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.88 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |