C10H16F3NO3 — CID 86738948
2,2,2-trifluoro-N-[(2S,3R,4S,6R)-6-methoxy-2,3-dimethyloxan-4-yl]acetamide (PubChem CID 86738948) has the molecular formula C10H16F3NO3 and a molecular weight of 255.24 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-[(2S,3R,4S,6R)-6-methoxy-2,3-dimethyloxan-4-yl]acetamide.
| Compound Name | 2,2,2-trifluoro-N-[(2S,3R,4S,6R)-6-methoxy-2,3-dimethyloxan-4-yl]acetamide |
|---|---|
| PubChem CID | 86738948 |
| Molecular Formula | C10H16F3NO3 |
| Molecular Weight | 255.24 g/mol |
| Exact Mass | 255.11 |
| IUPAC Name | 2,2,2-trifluoro-N-[(2S,3R,4S,6R)-6-methoxy-2,3-dimethyloxan-4-yl]acetamide |
| SMILES | CO[C@H]1C[C@H](NC(=O)C(F)(F)F)[C@@H](C)[C@H](C)O1 |
| InChI | InChI=1S/C10H16F3NO3/c1-5-6(2)17-8(16-3)4-7(5)14-9(15)10(11,12)13/h5-8H,4H2,1-3H3,(H,14,15)/t5-,6-,7-,8+/m0/s1 |
| InChIKey | QJXGCPLXGGDPCQ-DKXJUACHSA-N |
| XLogP | 1.45 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.24 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |