About ethyl carbamate;urea;diisocyanate
ethyl carbamate;urea;diisocyanate (PubChem CID 86739068) has the molecular formula C6H11N5O5-2
and a molecular weight of 233.18 g/mol. Its IUPAC name is ethyl carbamate;urea;diisocyanate.
Molecular Properties
| Compound Name | ethyl carbamate;urea;diisocyanate |
| PubChem CID | 86739068 |
| Molecular Formula | C6H11N5O5-2 |
| Molecular Weight | 233.18 g/mol |
| Exact Mass | 233.08 |
| IUPAC Name | ethyl carbamate;urea;diisocyanate |
| SMILES | CCOC(N)=O.NC(N)=O.[N-]=C=O.[N-]=C=O |
| InChI | InChI=1S/C3H7NO2.CH4N2O.2CNO/c1-2-6-3(4)5;2-1(3)4;2*2-1-3/h2H2,1H3,(H2,4,5);(H4,2,3,4);;/q;;2*-1 |
| InChIKey | DSIDKVYVAXAFSB-UHFFFAOYSA-N |
| XLogP | -1.09 |
| TPSA | 200.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.18 |
| LogP ≤ 5 | -1.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|
Analyze ethyl carbamate;urea;diisocyanate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl carbamate;urea;diisocyanate?
The IUPAC name of ethyl carbamate;urea;diisocyanate (CID 86739068) is ethyl carbamate;urea;diisocyanate.
What is the SMILES notation for ethyl carbamate;urea;diisocyanate?
The canonical SMILES for ethyl carbamate;urea;diisocyanate is CCOC(N)=O.NC(N)=O.[N-]=C=O.[N-]=C=O.
What is the InChIKey of ethyl carbamate;urea;diisocyanate?
The InChIKey is DSIDKVYVAXAFSB-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H7NO2.CH4N2O.2CNO/c1-2-6-3(4)5;2-1(3)4;2*2-1-3/h2H2,1H3,(H2,4,5);(H4,2,3,4);;/q;;2*-1.
What are the key properties of ethyl carbamate;urea;diisocyanate?
ethyl carbamate;urea;diisocyanate has a molecular weight of 233.18 g/mol, XLogP of -1.09, 1 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl carbamate;urea;diisocyanate is sourced from PubChem (CID 86739068), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).