C15H20Cl2N2O2 — CID 86739749
(2R,8aS)-4-(3-chloropropylamino)-3-hydroxy-2,3-dimethyl-2,8a-dihydrochromene-6-carbonitrile;hydrochloride (PubChem CID 86739749) has the molecular formula C15H20Cl2N2O2 and a molecular weight of 331.24 g/mol. Its IUPAC name is (2R,8aS)-4-(3-chloropropylamino)-3-hydroxy-2,3-dimethyl-2,8a-dihydrochromene-6-carbonitrile;hydrochloride.
| Compound Name | (2R,8aS)-4-(3-chloropropylamino)-3-hydroxy-2,3-dimethyl-2,8a-dihydrochromene-6-carbonitrile;hydrochloride |
|---|---|
| PubChem CID | 86739749 |
| Molecular Formula | C15H20Cl2N2O2 |
| Molecular Weight | 331.24 g/mol |
| Exact Mass | 330.09 |
| IUPAC Name | (2R,8aS)-4-(3-chloropropylamino)-3-hydroxy-2,3-dimethyl-2,8a-dihydrochromene-6-carbonitrile;hydrochloride |
| SMILES | C[C@H]1O[C@H]2C=CC(C#N)=CC2=C(NCCCCl)C1(C)O.Cl |
| InChI | InChI=1S/C15H19ClN2O2.ClH/c1-10-15(2,19)14(18-7-3-6-16)12-8-11(9-17)4-5-13(12)20-10;/h4-5,8,10,13,18-19H,3,6-7H2,1-2H3;1H/t10-,13+,15?;/m1./s1 |
| InChIKey | LVLJEZFKEHQGSO-HHTVQANXSA-N |
| XLogP | 2.44 |
| TPSA | 65.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.24 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|