About tert-butyl-[tert-butyl(dimethyl)silyl]oxy-dimethylsilane;7-iodohepta-4,5-dien-1-ol
tert-butyl-[tert-butyl(dimethyl)silyl]oxy-dimethylsilane;7-iodohepta-4,5-dien-1-ol (PubChem CID 86740082) has the molecular formula C19H41IO2Si2
and a molecular weight of 484.61 g/mol. Its IUPAC name is tert-butyl-[tert-butyl(dimethyl)silyl]oxy-dimethylsilane;7-iodohepta-4,5-dien-1-ol.
Molecular Properties
| Compound Name | tert-butyl-[tert-butyl(dimethyl)silyl]oxy-dimethylsilane;7-iodohepta-4,5-dien-1-ol |
| PubChem CID | 86740082 |
| Molecular Formula | C19H41IO2Si2 |
| Molecular Weight | 484.61 g/mol |
| Exact Mass | 484.17 |
| IUPAC Name | tert-butyl-[tert-butyl(dimethyl)silyl]oxy-dimethylsilane;7-iodohepta-4,5-dien-1-ol |
| SMILES | CC(C)(C)[Si](C)(C)O[Si](C)(C)C(C)(C)C.OCCCC=C=CCI |
| InChI | InChI=1S/C12H30OSi2.C7H11IO/c1-11(2,3)14(7,8)13-15(9,10)12(4,5)6;8-6-4-2-1-3-5-7-9/h1-10H3;1,4,9H,3,5-7H2 |
| InChIKey | SYKUVILOGNSIOL-UHFFFAOYSA-N |
| XLogP | 6.92 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 484.61 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl-[tert-butyl(dimethyl)silyl]oxy-dimethylsilane;7-iodohepta-4,5-dien-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl-[tert-butyl(dimethyl)silyl]oxy-dimethylsilane;7-iodohepta-4,5-dien-1-ol?
The IUPAC name of tert-butyl-[tert-butyl(dimethyl)silyl]oxy-dimethylsilane;7-iodohepta-4,5-dien-1-ol (CID 86740082) is tert-butyl-[tert-butyl(dimethyl)silyl]oxy-dimethylsilane;7-iodohepta-4,5-dien-1-ol.
What is the SMILES notation for tert-butyl-[tert-butyl(dimethyl)silyl]oxy-dimethylsilane;7-iodohepta-4,5-dien-1-ol?
The canonical SMILES for tert-butyl-[tert-butyl(dimethyl)silyl]oxy-dimethylsilane;7-iodohepta-4,5-dien-1-ol is CC(C)(C)[Si](C)(C)O[Si](C)(C)C(C)(C)C.OCCCC=C=CCI.
What is the InChIKey of tert-butyl-[tert-butyl(dimethyl)silyl]oxy-dimethylsilane;7-iodohepta-4,5-dien-1-ol?
The InChIKey is SYKUVILOGNSIOL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H30OSi2.C7H11IO/c1-11(2,3)14(7,8)13-15(9,10)12(4,5)6;8-6-4-2-1-3-5-7-9/h1-10H3;1,4,9H,3,5-7H2.
What are the key properties of tert-butyl-[tert-butyl(dimethyl)silyl]oxy-dimethylsilane;7-iodohepta-4,5-dien-1-ol?
tert-butyl-[tert-butyl(dimethyl)silyl]oxy-dimethylsilane;7-iodohepta-4,5-dien-1-ol has a molecular weight of 484.61 g/mol, XLogP of 6.92, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl-[tert-butyl(dimethyl)silyl]oxy-dimethylsilane;7-iodohepta-4,5-dien-1-ol is sourced from PubChem (CID 86740082), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).