C11H13NO — CID 86740278
1-hydroxy-5,6,7,8-tetrahydro-2H-naphthalene-1-carbonitrile (PubChem CID 86740278) has the molecular formula C11H13NO and a molecular weight of 175.23 g/mol. Its IUPAC name is 1-hydroxy-5,6,7,8-tetrahydro-2H-naphthalene-1-carbonitrile.
| Compound Name | 1-hydroxy-5,6,7,8-tetrahydro-2H-naphthalene-1-carbonitrile |
|---|---|
| PubChem CID | 86740278 |
| Molecular Formula | C11H13NO |
| Molecular Weight | 175.23 g/mol |
| Exact Mass | 175.10 |
| IUPAC Name | 1-hydroxy-5,6,7,8-tetrahydro-2H-naphthalene-1-carbonitrile |
| SMILES | N#CC1(O)CC=CC2=C1CCCC2 |
| InChI | InChI=1S/C11H13NO/c12-8-11(13)7-3-5-9-4-1-2-6-10(9)11/h3,5,13H,1-2,4,6-7H2 |
| InChIKey | AYBOXNGLORFMKN-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 44.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.23 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'cyanohydrins', 'substructure': 'N/A'} |
|---|