About 1-Isopropylidenamino-5-mercapto-1H-tetrazole sodium salt
1-Isopropylidenamino-5-mercapto-1H-tetrazole sodium salt (PubChem CID 86740678) has the molecular formula C4H7N5NaS
and a molecular weight of 180.19 g/mol.
Molecular Properties
| Compound Name | 1-Isopropylidenamino-5-mercapto-1H-tetrazole sodium salt |
| PubChem CID | 86740678 |
| Molecular Formula | C4H7N5NaS |
| Molecular Weight | 180.19 g/mol |
| Exact Mass | 180.03 |
| IUPAC Name | — |
| SMILES | CC(C)=Nn1[nH]nnc1=S.[Na] |
| InChI | InChI=1S/C4H7N5S.Na/c1-3(2)6-9-4(10)5-7-8-9;/h1-2H3,(H,5,8,10); |
| InChIKey | TVRFUCYQUPFPLW-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 58.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.19 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1-Isopropylidenamino-5-mercapto-1H-tetrazole sodium salt with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-Isopropylidenamino-5-mercapto-1H-tetrazole sodium salt?
The IUPAC name of 1-Isopropylidenamino-5-mercapto-1H-tetrazole sodium salt (CID 86740678) is not available.
What is the SMILES notation for 1-Isopropylidenamino-5-mercapto-1H-tetrazole sodium salt?
The canonical SMILES for 1-Isopropylidenamino-5-mercapto-1H-tetrazole sodium salt is CC(C)=Nn1[nH]nnc1=S.[Na].
What is the InChIKey of 1-Isopropylidenamino-5-mercapto-1H-tetrazole sodium salt?
The InChIKey is TVRFUCYQUPFPLW-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H7N5S.Na/c1-3(2)6-9-4(10)5-7-8-9;/h1-2H3,(H,5,8,10);.
What are the key properties of 1-Isopropylidenamino-5-mercapto-1H-tetrazole sodium salt?
1-Isopropylidenamino-5-mercapto-1H-tetrazole sodium salt has a molecular weight of 180.19 g/mol, XLogP of 0.20, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-Isopropylidenamino-5-mercapto-1H-tetrazole sodium salt is sourced from PubChem (CID 86740678), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).