About 2-acetamidoacetic acid;(4-methylphenyl)-(1-methylpyrrol-2-yl)methanone
2-acetamidoacetic acid;(4-methylphenyl)-(1-methylpyrrol-2-yl)methanone (PubChem CID 86740698) has the molecular formula C17H20N2O4
and a molecular weight of 316.36 g/mol. Its IUPAC name is 2-acetamidoacetic acid;(4-methylphenyl)-(1-methylpyrrol-2-yl)methanone.
Molecular Properties
| Compound Name | 2-acetamidoacetic acid;(4-methylphenyl)-(1-methylpyrrol-2-yl)methanone |
| PubChem CID | 86740698 |
| Molecular Formula | C17H20N2O4 |
| Molecular Weight | 316.36 g/mol |
| Exact Mass | 316.14 |
| IUPAC Name | 2-acetamidoacetic acid;(4-methylphenyl)-(1-methylpyrrol-2-yl)methanone |
| SMILES | CC(=O)NCC(=O)O.Cc1ccc(C(=O)c2cccn2C)cc1 |
| InChI | InChI=1S/C13H13NO.C4H7NO3/c1-10-5-7-11(8-6-10)13(15)12-4-3-9-14(12)2;1-3(6)5-2-4(7)8/h3-9H,1-2H3;2H2,1H3,(H,5,6)(H,7,8) |
| InChIKey | GZQHOTPDLORUIU-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 88.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.36 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-acetamidoacetic acid;(4-methylphenyl)-(1-methylpyrrol-2-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-acetamidoacetic acid;(4-methylphenyl)-(1-methylpyrrol-2-yl)methanone?
The IUPAC name of 2-acetamidoacetic acid;(4-methylphenyl)-(1-methylpyrrol-2-yl)methanone (CID 86740698) is 2-acetamidoacetic acid;(4-methylphenyl)-(1-methylpyrrol-2-yl)methanone.
What is the SMILES notation for 2-acetamidoacetic acid;(4-methylphenyl)-(1-methylpyrrol-2-yl)methanone?
The canonical SMILES for 2-acetamidoacetic acid;(4-methylphenyl)-(1-methylpyrrol-2-yl)methanone is CC(=O)NCC(=O)O.Cc1ccc(C(=O)c2cccn2C)cc1.
What is the InChIKey of 2-acetamidoacetic acid;(4-methylphenyl)-(1-methylpyrrol-2-yl)methanone?
The InChIKey is GZQHOTPDLORUIU-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13NO.C4H7NO3/c1-10-5-7-11(8-6-10)13(15)12-4-3-9-14(12)2;1-3(6)5-2-4(7)8/h3-9H,1-2H3;2H2,1H3,(H,5,6)(H,7,8).
What are the key properties of 2-acetamidoacetic acid;(4-methylphenyl)-(1-methylpyrrol-2-yl)methanone?
2-acetamidoacetic acid;(4-methylphenyl)-(1-methylpyrrol-2-yl)methanone has a molecular weight of 316.36 g/mol, XLogP of 1.77, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-acetamidoacetic acid;(4-methylphenyl)-(1-methylpyrrol-2-yl)methanone is sourced from PubChem (CID 86740698), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).