C18H27N2O3- — CID 86740910
N-tert-butyl-N-[1-[(4-methoxyphenyl)methyl]piperidin-4-yl]carbamate (PubChem CID 86740910) has the molecular formula C18H27N2O3- and a molecular weight of 319.43 g/mol. Its IUPAC name is N-tert-butyl-N-[1-[(4-methoxyphenyl)methyl]piperidin-4-yl]carbamate.
| Compound Name | N-tert-butyl-N-[1-[(4-methoxyphenyl)methyl]piperidin-4-yl]carbamate |
|---|---|
| PubChem CID | 86740910 |
| Molecular Formula | C18H27N2O3- |
| Molecular Weight | 319.43 g/mol |
| Exact Mass | 319.20 |
| IUPAC Name | N-tert-butyl-N-[1-[(4-methoxyphenyl)methyl]piperidin-4-yl]carbamate |
| SMILES | COc1ccc(CN2CCC(N(C(=O)[O-])C(C)(C)C)CC2)cc1 |
| InChI | InChI=1S/C18H28N2O3/c1-18(2,3)20(17(21)22)15-9-11-19(12-10-15)13-14-5-7-16(23-4)8-6-14/h5-8,15H,9-13H2,1-4H3,(H,21,22)/p-1 |
| InChIKey | JKYVVAINDRZMIM-UHFFFAOYSA-M |
| XLogP | 2.10 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.43 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |