About triphenyl(pyridin-4-ylmethyl)phosphanium;iodide;hydrochloride
triphenyl(pyridin-4-ylmethyl)phosphanium;iodide;hydrochloride (PubChem CID 86741343) has the molecular formula C24H22ClINP
and a molecular weight of 517.78 g/mol. Its IUPAC name is triphenyl(pyridin-4-ylmethyl)phosphanium;iodide;hydrochloride.
Molecular Properties
| Compound Name | triphenyl(pyridin-4-ylmethyl)phosphanium;iodide;hydrochloride |
| PubChem CID | 86741343 |
| Molecular Formula | C24H22ClINP |
| Molecular Weight | 517.78 g/mol |
| Exact Mass | 517.02 |
| IUPAC Name | triphenyl(pyridin-4-ylmethyl)phosphanium;iodide;hydrochloride |
| SMILES | Cl.[I-].c1ccc([P+](Cc2ccncc2)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C24H21NP.ClH.HI/c1-4-10-22(11-5-1)26(23-12-6-2-7-13-23,24-14-8-3-9-15-24)20-21-16-18-25-19-17-21;;/h1-19H,20H2;2*1H/q+1;;/p-1 |
| InChIKey | RFTFTEYFZPNZIL-UHFFFAOYSA-M |
| XLogP | 2.00 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 517.78 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze triphenyl(pyridin-4-ylmethyl)phosphanium;iodide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of triphenyl(pyridin-4-ylmethyl)phosphanium;iodide;hydrochloride?
The IUPAC name of triphenyl(pyridin-4-ylmethyl)phosphanium;iodide;hydrochloride (CID 86741343) is triphenyl(pyridin-4-ylmethyl)phosphanium;iodide;hydrochloride.
What is the SMILES notation for triphenyl(pyridin-4-ylmethyl)phosphanium;iodide;hydrochloride?
The canonical SMILES for triphenyl(pyridin-4-ylmethyl)phosphanium;iodide;hydrochloride is Cl.[I-].c1ccc([P+](Cc2ccncc2)(c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of triphenyl(pyridin-4-ylmethyl)phosphanium;iodide;hydrochloride?
The InChIKey is RFTFTEYFZPNZIL-UHFFFAOYSA-M. The full InChI is InChI=1S/C24H21NP.ClH.HI/c1-4-10-22(11-5-1)26(23-12-6-2-7-13-23,24-14-8-3-9-15-24)20-21-16-18-25-19-17-21;;/h1-19H,20H2;2*1H/q+1;;/p-1.
What are the key properties of triphenyl(pyridin-4-ylmethyl)phosphanium;iodide;hydrochloride?
triphenyl(pyridin-4-ylmethyl)phosphanium;iodide;hydrochloride has a molecular weight of 517.78 g/mol, XLogP of 2.00, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for triphenyl(pyridin-4-ylmethyl)phosphanium;iodide;hydrochloride is sourced from PubChem (CID 86741343), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).