About 4,6-dimethoxy-3-methyl-5-sulfonylcyclohexa-1,3-diene-1-carbonyl chloride
4,6-dimethoxy-3-methyl-5-sulfonylcyclohexa-1,3-diene-1-carbonyl chloride (PubChem CID 86741590) has the molecular formula C10H11ClO5S
and a molecular weight of 278.71 g/mol. Its IUPAC name is 4,6-dimethoxy-3-methyl-5-sulfonylcyclohexa-1,3-diene-1-carbonyl chloride.
Molecular Properties
| Compound Name | 4,6-dimethoxy-3-methyl-5-sulfonylcyclohexa-1,3-diene-1-carbonyl chloride |
| PubChem CID | 86741590 |
| Molecular Formula | C10H11ClO5S |
| Molecular Weight | 278.71 g/mol |
| Exact Mass | 278.00 |
| IUPAC Name | 4,6-dimethoxy-3-methyl-5-sulfonylcyclohexa-1,3-diene-1-carbonyl chloride |
| SMILES | COC1=C(C)C=C(C(=O)Cl)C(OC)C1=S(=O)=O |
| InChI | InChI=1S/C10H11ClO5S/c1-5-4-6(10(11)12)8(16-3)9(17(13)14)7(5)15-2/h4,8H,1-3H3 |
| InChIKey | KQDBGFSWLVUZLL-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.71 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 4,6-dimethoxy-3-methyl-5-sulfonylcyclohexa-1,3-diene-1-carbonyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,6-dimethoxy-3-methyl-5-sulfonylcyclohexa-1,3-diene-1-carbonyl chloride?
The IUPAC name of 4,6-dimethoxy-3-methyl-5-sulfonylcyclohexa-1,3-diene-1-carbonyl chloride (CID 86741590) is 4,6-dimethoxy-3-methyl-5-sulfonylcyclohexa-1,3-diene-1-carbonyl chloride.
What is the SMILES notation for 4,6-dimethoxy-3-methyl-5-sulfonylcyclohexa-1,3-diene-1-carbonyl chloride?
The canonical SMILES for 4,6-dimethoxy-3-methyl-5-sulfonylcyclohexa-1,3-diene-1-carbonyl chloride is COC1=C(C)C=C(C(=O)Cl)C(OC)C1=S(=O)=O.
What is the InChIKey of 4,6-dimethoxy-3-methyl-5-sulfonylcyclohexa-1,3-diene-1-carbonyl chloride?
The InChIKey is KQDBGFSWLVUZLL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11ClO5S/c1-5-4-6(10(11)12)8(16-3)9(17(13)14)7(5)15-2/h4,8H,1-3H3.
What are the key properties of 4,6-dimethoxy-3-methyl-5-sulfonylcyclohexa-1,3-diene-1-carbonyl chloride?
4,6-dimethoxy-3-methyl-5-sulfonylcyclohexa-1,3-diene-1-carbonyl chloride has a molecular weight of 278.71 g/mol, XLogP of 0.68, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4,6-dimethoxy-3-methyl-5-sulfonylcyclohexa-1,3-diene-1-carbonyl chloride is sourced from PubChem (CID 86741590), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).