C15H12FN5O3S2 — CID 8674171
N'-[2-[[5-(3-fluoroanilino)-1,3,4-thiadiazol-2-yl]sulfanyl]acetyl]furan-2-carbohydrazide (PubChem CID 8674171) has the molecular formula C15H12FN5O3S2 and a molecular weight of 393.43 g/mol. Its IUPAC name is N'-[2-[[5-(3-fluoroanilino)-1,3,4-thiadiazol-2-yl]sulfanyl]acetyl]furan-2-carbohydrazide.
| Compound Name | N'-[2-[[5-(3-fluoroanilino)-1,3,4-thiadiazol-2-yl]sulfanyl]acetyl]furan-2-carbohydrazide |
|---|---|
| PubChem CID | 8674171 |
| Molecular Formula | C15H12FN5O3S2 |
| Molecular Weight | 393.43 g/mol |
| Exact Mass | 393.04 |
| IUPAC Name | N'-[2-[[5-(3-fluoroanilino)-1,3,4-thiadiazol-2-yl]sulfanyl]acetyl]furan-2-carbohydrazide |
| SMILES | O=C(CSc1nnc(Nc2cccc(F)c2)s1)NNC(=O)c1ccco1 |
| InChI | InChI=1S/C15H12FN5O3S2/c16-9-3-1-4-10(7-9)17-14-20-21-15(26-14)25-8-12(22)18-19-13(23)11-5-2-6-24-11/h1-7H,8H2,(H,17,20)(H,18,22)(H,19,23) |
| InChIKey | WMEIYRDEPFTQPR-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 109.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.43 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|