About N,N-dimethylformamide;methanethiol
N,N-dimethylformamide;methanethiol (PubChem CID 86741828) has the molecular formula C4H11NOS
and a molecular weight of 121.20 g/mol. Its IUPAC name is N,N-dimethylformamide;methanethiol.
Molecular Properties
| Compound Name | N,N-dimethylformamide;methanethiol |
| PubChem CID | 86741828 |
| Molecular Formula | C4H11NOS |
| Molecular Weight | 121.20 g/mol |
| Exact Mass | 121.06 |
| IUPAC Name | N,N-dimethylformamide;methanethiol |
| SMILES | CN(C)C=O.CS |
| InChI | InChI=1S/C3H7NO.CH4S/c1-4(2)3-5;1-2/h3H,1-2H3;2H,1H3 |
| InChIKey | XJXVVQHIQXKAEV-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 20.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 121.20 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze N,N-dimethylformamide;methanethiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dimethylformamide;methanethiol?
The IUPAC name of N,N-dimethylformamide;methanethiol (CID 86741828) is N,N-dimethylformamide;methanethiol.
What is the SMILES notation for N,N-dimethylformamide;methanethiol?
The canonical SMILES for N,N-dimethylformamide;methanethiol is CN(C)C=O.CS.
What is the InChIKey of N,N-dimethylformamide;methanethiol?
The InChIKey is XJXVVQHIQXKAEV-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H7NO.CH4S/c1-4(2)3-5;1-2/h3H,1-2H3;2H,1H3.
What are the key properties of N,N-dimethylformamide;methanethiol?
N,N-dimethylformamide;methanethiol has a molecular weight of 121.20 g/mol, XLogP of 0.25, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dimethylformamide;methanethiol is sourced from PubChem (CID 86741828), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).