About acetic acid;(2R,3R)-2-amino-2-methylbutane-1,3-diol
acetic acid;(2R,3R)-2-amino-2-methylbutane-1,3-diol (PubChem CID 86741969) has the molecular formula C7H17NO4
and a molecular weight of 179.22 g/mol. Its IUPAC name is acetic acid;(2R,3R)-2-amino-2-methylbutane-1,3-diol.
Molecular Properties
| Compound Name | acetic acid;(2R,3R)-2-amino-2-methylbutane-1,3-diol |
| PubChem CID | 86741969 |
| Molecular Formula | C7H17NO4 |
| Molecular Weight | 179.22 g/mol |
| Exact Mass | 179.12 |
| IUPAC Name | acetic acid;(2R,3R)-2-amino-2-methylbutane-1,3-diol |
| SMILES | CC(=O)O.C[C@@H](O)[C@](C)(N)CO |
| InChI | InChI=1S/C5H13NO2.C2H4O2/c1-4(8)5(2,6)3-7;1-2(3)4/h4,7-8H,3,6H2,1-2H3;1H3,(H,3,4)/t4-,5-;/m1./s1 |
| InChIKey | ILCBNWNAUQJEEW-TYSVMGFPSA-N |
| XLogP | -0.83 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.22 |
| LogP ≤ 5 | -0.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze acetic acid;(2R,3R)-2-amino-2-methylbutane-1,3-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetic acid;(2R,3R)-2-amino-2-methylbutane-1,3-diol?
The IUPAC name of acetic acid;(2R,3R)-2-amino-2-methylbutane-1,3-diol (CID 86741969) is acetic acid;(2R,3R)-2-amino-2-methylbutane-1,3-diol.
What is the SMILES notation for acetic acid;(2R,3R)-2-amino-2-methylbutane-1,3-diol?
The canonical SMILES for acetic acid;(2R,3R)-2-amino-2-methylbutane-1,3-diol is CC(=O)O.C[C@@H](O)[C@](C)(N)CO.
What is the InChIKey of acetic acid;(2R,3R)-2-amino-2-methylbutane-1,3-diol?
The InChIKey is ILCBNWNAUQJEEW-TYSVMGFPSA-N. The full InChI is InChI=1S/C5H13NO2.C2H4O2/c1-4(8)5(2,6)3-7;1-2(3)4/h4,7-8H,3,6H2,1-2H3;1H3,(H,3,4)/t4-,5-;/m1./s1.
What are the key properties of acetic acid;(2R,3R)-2-amino-2-methylbutane-1,3-diol?
acetic acid;(2R,3R)-2-amino-2-methylbutane-1,3-diol has a molecular weight of 179.22 g/mol, XLogP of -0.83, 2 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for acetic acid;(2R,3R)-2-amino-2-methylbutane-1,3-diol is sourced from PubChem (CID 86741969), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).