C38H56NO5- — CID 86742196
(1S,3R,6S,8R,11S,12S,15R,16R)-15-[(2R)-5,6-dimethylhept-5-en-2-yl]-7,7,12,16-tetramethylpentacyclo[9.7.0.01,3.03,8.012,16]octadecan-6-ol;4-nitrobenzoate (PubChem CID 86742196) has the molecular formula C38H56NO5- and a molecular weight of 606.87 g/mol. Its IUPAC name is (1S,3R,6S,8R,11S,12S,15R,16R)-15-[(2R)-5,6-dimethylhept-5-en-2-yl]-7,7,12,16-tetramethylpentacyclo[9.7.0.01,3.03,8.012,16]octadecan-6-ol;4-nitrobenzoate.
| Compound Name | (1S,3R,6S,8R,11S,12S,15R,16R)-15-[(2R)-5,6-dimethylhept-5-en-2-yl]-7,7,12,16-tetramethylpentacyclo[9.7.0.01,3.03,8.012,16]octadecan-6-ol;4-nitrobenzoate |
|---|---|
| PubChem CID | 86742196 |
| Molecular Formula | C38H56NO5- |
| Molecular Weight | 606.87 g/mol |
| Exact Mass | 606.42 |
| IUPAC Name | (1S,3R,6S,8R,11S,12S,15R,16R)-15-[(2R)-5,6-dimethylhept-5-en-2-yl]-7,7,12,16-tetramethylpentacyclo[9.7.0.01,3.03,8.012,16]octadecan-6-ol;4-nitrobenzoate |
| SMILES | CC(C)=C(C)CC[C@@H](C)[C@H]1CC[C@@]2(C)[C@@H]3CC[C@H]4C(C)(C)[C@@H](O)CC[C@@]45C[C@@]35CC[C@]12C.O=C([O-])c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C31H52O.C7H5NO4/c1-20(2)21(3)9-10-22(4)23-13-15-29(8)25-12-11-24-27(5,6)26(32)14-16-30(24)19-31(25,30)18-17-28(23,29)7;9-7(10)5-1-3-6(4-2-5)8(11)12/h22-26,32H,9-19H2,1-8H3;1-4H,(H,9,10)/p-1/t22-,23-,24+,25+,26+,28-,29+,30-,31+;/m1./s1 |
| InChIKey | LKKFUJXHJWWUOE-NIUOOVCQSA-M |
| XLogP | 8.52 |
| TPSA | 103.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.87 |
| LogP ≤ 5 | 8.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|