About sodium 1-[2,3-dichloro-4-[(E)-2-nitrobut-1-enyl]phenoxy]cyclobutane-1-carboxylate
sodium 1-[2,3-dichloro-4-[(E)-2-nitrobut-1-enyl]phenoxy]cyclobutane-1-carboxylate (PubChem CID 86742222) has the molecular formula C15H14Cl2NNaO5
and a molecular weight of 382.18 g/mol. Its IUPAC name is sodium 1-[2,3-dichloro-4-[(E)-2-nitrobut-1-enyl]phenoxy]cyclobutane-1-carboxylate.
Molecular Properties
| Compound Name | sodium 1-[2,3-dichloro-4-[(E)-2-nitrobut-1-enyl]phenoxy]cyclobutane-1-carboxylate |
| PubChem CID | 86742222 |
| Molecular Formula | C15H14Cl2NNaO5 |
| Molecular Weight | 382.18 g/mol |
| Exact Mass | 381.01 |
| IUPAC Name | sodium 1-[2,3-dichloro-4-[(E)-2-nitrobut-1-enyl]phenoxy]cyclobutane-1-carboxylate |
| SMILES | CC/C(=C\c1ccc(OC2(C(=O)[O-])CCC2)c(Cl)c1Cl)[N+](=O)[O-].[Na+] |
| InChI | InChI=1S/C15H15Cl2NO5.Na/c1-2-10(18(21)22)8-9-4-5-11(13(17)12(9)16)23-15(14(19)20)6-3-7-15;/h4-5,8H,2-3,6-7H2,1H3,(H,19,20);/q;+1/p-1/b10-8+; |
| InChIKey | LERCORYTMPBGGI-VRTOBVRTSA-M |
| XLogP | 0.08 |
| TPSA | 92.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 382.18 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze sodium 1-[2,3-dichloro-4-[(E)-2-nitrobut-1-enyl]phenoxy]cyclobutane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium 1-[2,3-dichloro-4-[(E)-2-nitrobut-1-enyl]phenoxy]cyclobutane-1-carboxylate?
The IUPAC name of sodium 1-[2,3-dichloro-4-[(E)-2-nitrobut-1-enyl]phenoxy]cyclobutane-1-carboxylate (CID 86742222) is sodium 1-[2,3-dichloro-4-[(E)-2-nitrobut-1-enyl]phenoxy]cyclobutane-1-carboxylate.
What is the SMILES notation for sodium 1-[2,3-dichloro-4-[(E)-2-nitrobut-1-enyl]phenoxy]cyclobutane-1-carboxylate?
The canonical SMILES for sodium 1-[2,3-dichloro-4-[(E)-2-nitrobut-1-enyl]phenoxy]cyclobutane-1-carboxylate is CC/C(=C\c1ccc(OC2(C(=O)[O-])CCC2)c(Cl)c1Cl)[N+](=O)[O-].[Na+].
What is the InChIKey of sodium 1-[2,3-dichloro-4-[(E)-2-nitrobut-1-enyl]phenoxy]cyclobutane-1-carboxylate?
The InChIKey is LERCORYTMPBGGI-VRTOBVRTSA-M. The full InChI is InChI=1S/C15H15Cl2NO5.Na/c1-2-10(18(21)22)8-9-4-5-11(13(17)12(9)16)23-15(14(19)20)6-3-7-15;/h4-5,8H,2-3,6-7H2,1H3,(H,19,20);/q;+1/p-1/b10-8+;.
What are the key properties of sodium 1-[2,3-dichloro-4-[(E)-2-nitrobut-1-enyl]phenoxy]cyclobutane-1-carboxylate?
sodium 1-[2,3-dichloro-4-[(E)-2-nitrobut-1-enyl]phenoxy]cyclobutane-1-carboxylate has a molecular weight of 382.18 g/mol, XLogP of 0.08, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for sodium 1-[2,3-dichloro-4-[(E)-2-nitrobut-1-enyl]phenoxy]cyclobutane-1-carboxylate is sourced from PubChem (CID 86742222), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).