C22H31N5O4 — CID 86742349
3-[(6aR,9S,10aR)-4-acetyl-7-methyl-1-nitro-5,5a,6,6a,8,9,10,10a-octahydroindolo[4,3-fg]quinolin-9-yl]-1,1-diethylurea (PubChem CID 86742349) has the molecular formula C22H31N5O4 and a molecular weight of 429.52 g/mol. Its IUPAC name is 3-[(6aR,9S,10aR)-4-acetyl-7-methyl-1-nitro-5,5a,6,6a,8,9,10,10a-octahydroindolo[4,3-fg]quinolin-9-yl]-1,1-diethylurea.
| Compound Name | 3-[(6aR,9S,10aR)-4-acetyl-7-methyl-1-nitro-5,5a,6,6a,8,9,10,10a-octahydroindolo[4,3-fg]quinolin-9-yl]-1,1-diethylurea |
|---|---|
| PubChem CID | 86742349 |
| Molecular Formula | C22H31N5O4 |
| Molecular Weight | 429.52 g/mol |
| Exact Mass | 429.24 |
| IUPAC Name | 3-[(6aR,9S,10aR)-4-acetyl-7-methyl-1-nitro-5,5a,6,6a,8,9,10,10a-octahydroindolo[4,3-fg]quinolin-9-yl]-1,1-diethylurea |
| SMILES | CCN(CC)C(=O)N[C@H]1C[C@@H]2c3c([N+](=O)[O-])ccc4c3C(C[C@H]2N(C)C1)CN4C(C)=O |
| InChI | InChI=1S/C22H31N5O4/c1-5-25(6-2)22(29)23-15-10-16-19(24(4)12-15)9-14-11-26(13(3)28)17-7-8-18(27(30)31)21(16)20(14)17/h7-8,14-16,19H,5-6,9-12H2,1-4H3,(H,23,29)/t14?,15-,16-,19+/m0/s1 |
| InChIKey | BVPSELBUONNCHQ-RIIFBVBQSA-N |
| XLogP | 2.66 |
| TPSA | 99.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.52 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|