About (2R,3S)-2-methyl-2-(pyren-1-ylmethylamino)butane-1,3-diol;hydrochloride
(2R,3S)-2-methyl-2-(pyren-1-ylmethylamino)butane-1,3-diol;hydrochloride (PubChem CID 86742932) has the molecular formula C22H24ClNO2
and a molecular weight of 369.89 g/mol. Its IUPAC name is (2R,3S)-2-methyl-2-(pyren-1-ylmethylamino)butane-1,3-diol;hydrochloride.
Molecular Properties
| Compound Name | (2R,3S)-2-methyl-2-(pyren-1-ylmethylamino)butane-1,3-diol;hydrochloride |
| PubChem CID | 86742932 |
| Molecular Formula | C22H24ClNO2 |
| Molecular Weight | 369.89 g/mol |
| Exact Mass | 369.15 |
| IUPAC Name | (2R,3S)-2-methyl-2-(pyren-1-ylmethylamino)butane-1,3-diol;hydrochloride |
| SMILES | C[C@H](O)[C@@](C)(CO)NCc1ccc2ccc3cccc4ccc1c2c34.Cl |
| InChI | InChI=1S/C22H23NO2.ClH/c1-14(25)22(2,13-24)23-12-18-9-8-17-7-6-15-4-3-5-16-10-11-19(18)21(17)20(15)16;/h3-11,14,23-25H,12-13H2,1-2H3;1H/t14-,22+;/m0./s1 |
| InChIKey | QJJIGOCEWHMZRT-ROYXODNVSA-N |
| XLogP | 4.23 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 369.89 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze (2R,3S)-2-methyl-2-(pyren-1-ylmethylamino)butane-1,3-diol;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R,3S)-2-methyl-2-(pyren-1-ylmethylamino)butane-1,3-diol;hydrochloride?
The IUPAC name of (2R,3S)-2-methyl-2-(pyren-1-ylmethylamino)butane-1,3-diol;hydrochloride (CID 86742932) is (2R,3S)-2-methyl-2-(pyren-1-ylmethylamino)butane-1,3-diol;hydrochloride.
What is the SMILES notation for (2R,3S)-2-methyl-2-(pyren-1-ylmethylamino)butane-1,3-diol;hydrochloride?
The canonical SMILES for (2R,3S)-2-methyl-2-(pyren-1-ylmethylamino)butane-1,3-diol;hydrochloride is C[C@H](O)[C@@](C)(CO)NCc1ccc2ccc3cccc4ccc1c2c34.Cl.
What is the InChIKey of (2R,3S)-2-methyl-2-(pyren-1-ylmethylamino)butane-1,3-diol;hydrochloride?
The InChIKey is QJJIGOCEWHMZRT-ROYXODNVSA-N. The full InChI is InChI=1S/C22H23NO2.ClH/c1-14(25)22(2,13-24)23-12-18-9-8-17-7-6-15-4-3-5-16-10-11-19(18)21(17)20(15)16;/h3-11,14,23-25H,12-13H2,1-2H3;1H/t14-,22+;/m0./s1.
What are the key properties of (2R,3S)-2-methyl-2-(pyren-1-ylmethylamino)butane-1,3-diol;hydrochloride?
(2R,3S)-2-methyl-2-(pyren-1-ylmethylamino)butane-1,3-diol;hydrochloride has a molecular weight of 369.89 g/mol, XLogP of 4.23, 5 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2R,3S)-2-methyl-2-(pyren-1-ylmethylamino)butane-1,3-diol;hydrochloride is sourced from PubChem (CID 86742932), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).