C24H44O3Si — CID 86743006
propan-2-yl (6E)-10-[tert-butyl(dimethyl)silyl]oxy-3,7,11-trimethyldodeca-2,6,11-trienoate (PubChem CID 86743006) has the molecular formula C24H44O3Si and a molecular weight of 408.70 g/mol. Its IUPAC name is propan-2-yl (6E)-10-[tert-butyl(dimethyl)silyl]oxy-3,7,11-trimethyldodeca-2,6,11-trienoate.
| Compound Name | propan-2-yl (6E)-10-[tert-butyl(dimethyl)silyl]oxy-3,7,11-trimethyldodeca-2,6,11-trienoate |
|---|---|
| PubChem CID | 86743006 |
| Molecular Formula | C24H44O3Si |
| Molecular Weight | 408.70 g/mol |
| Exact Mass | 408.31 |
| IUPAC Name | propan-2-yl (6E)-10-[tert-butyl(dimethyl)silyl]oxy-3,7,11-trimethyldodeca-2,6,11-trienoate |
| SMILES | C=C(C)C(CC/C(C)=C/CCC(C)=CC(=O)OC(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C24H44O3Si/c1-18(2)22(27-28(10,11)24(7,8)9)16-15-20(5)13-12-14-21(6)17-23(25)26-19(3)4/h13,17,19,22H,1,12,14-16H2,2-11H3/b20-13+,21-17? |
| InChIKey | QLCZWAGSUBIYEL-HZAXEUGMSA-N |
| XLogP | 7.36 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.70 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|