C23H29ClN2O8 — CID 86744867
bis((Z)-but-2-enedioic acid);2-(8-chloro-1,2,3,4-tetrahydronaphthalen-2-yl)-1-methylpiperazine (PubChem CID 86744867) has the molecular formula C23H29ClN2O8 and a molecular weight of 496.94 g/mol. Its IUPAC name is bis((Z)-but-2-enedioic acid);2-(8-chloro-1,2,3,4-tetrahydronaphthalen-2-yl)-1-methylpiperazine.
| Compound Name | bis((Z)-but-2-enedioic acid);2-(8-chloro-1,2,3,4-tetrahydronaphthalen-2-yl)-1-methylpiperazine |
|---|---|
| PubChem CID | 86744867 |
| Molecular Formula | C23H29ClN2O8 |
| Molecular Weight | 496.94 g/mol |
| Exact Mass | 496.16 |
| IUPAC Name | bis((Z)-but-2-enedioic acid);2-(8-chloro-1,2,3,4-tetrahydronaphthalen-2-yl)-1-methylpiperazine |
| SMILES | CN1CCNCC1C1CCc2cccc(Cl)c2C1.O=C(O)/C=C\C(=O)O.O=C(O)/C=C\C(=O)O |
| InChI | InChI=1S/C15H21ClN2.2C4H4O4/c1-18-8-7-17-10-15(18)12-6-5-11-3-2-4-14(16)13(11)9-12;2*5-3(6)1-2-4(7)8/h2-4,12,15,17H,5-10H2,1H3;2*1-2H,(H,5,6)(H,7,8)/b;2*2-1- |
| InChIKey | WDISODINUGGKJG-SPIKMXEPSA-N |
| XLogP | 1.77 |
| TPSA | 164.47 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.94 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|