About 1-(1,3-dimethyl-2-sulfanylideneimidazolidin-4-yl)-3-methylurea
1-(1,3-dimethyl-2-sulfanylideneimidazolidin-4-yl)-3-methylurea (PubChem CID 86744904) has the molecular formula C7H14N4OS
and a molecular weight of 202.28 g/mol. Its IUPAC name is 1-(1,3-dimethyl-2-sulfanylideneimidazolidin-4-yl)-3-methylurea.
Molecular Properties
| Compound Name | 1-(1,3-dimethyl-2-sulfanylideneimidazolidin-4-yl)-3-methylurea |
| PubChem CID | 86744904 |
| Molecular Formula | C7H14N4OS |
| Molecular Weight | 202.28 g/mol |
| Exact Mass | 202.09 |
| IUPAC Name | 1-(1,3-dimethyl-2-sulfanylideneimidazolidin-4-yl)-3-methylurea |
| SMILES | CNC(=O)NC1CN(C)C(=S)N1C |
| InChI | InChI=1S/C7H14N4OS/c1-8-6(12)9-5-4-10(2)7(13)11(5)3/h5H,4H2,1-3H3,(H2,8,9,12) |
| InChIKey | IXHAUTPGYGJOSU-UHFFFAOYSA-N |
| XLogP | -0.60 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.28 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1-(1,3-dimethyl-2-sulfanylideneimidazolidin-4-yl)-3-methylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1,3-dimethyl-2-sulfanylideneimidazolidin-4-yl)-3-methylurea?
The IUPAC name of 1-(1,3-dimethyl-2-sulfanylideneimidazolidin-4-yl)-3-methylurea (CID 86744904) is 1-(1,3-dimethyl-2-sulfanylideneimidazolidin-4-yl)-3-methylurea.
What is the SMILES notation for 1-(1,3-dimethyl-2-sulfanylideneimidazolidin-4-yl)-3-methylurea?
The canonical SMILES for 1-(1,3-dimethyl-2-sulfanylideneimidazolidin-4-yl)-3-methylurea is CNC(=O)NC1CN(C)C(=S)N1C.
What is the InChIKey of 1-(1,3-dimethyl-2-sulfanylideneimidazolidin-4-yl)-3-methylurea?
The InChIKey is IXHAUTPGYGJOSU-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14N4OS/c1-8-6(12)9-5-4-10(2)7(13)11(5)3/h5H,4H2,1-3H3,(H2,8,9,12).
What are the key properties of 1-(1,3-dimethyl-2-sulfanylideneimidazolidin-4-yl)-3-methylurea?
1-(1,3-dimethyl-2-sulfanylideneimidazolidin-4-yl)-3-methylurea has a molecular weight of 202.28 g/mol, XLogP of -0.60, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1,3-dimethyl-2-sulfanylideneimidazolidin-4-yl)-3-methylurea is sourced from PubChem (CID 86744904), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).