C11H20F6N2O6S2 — CID 86745454
bis(trifluoromethanesulfonate);1,2,4-trimethyl-1,4-diazoniabicyclo[2.2.2]octane (PubChem CID 86745454) has the molecular formula C11H20F6N2O6S2 and a molecular weight of 454.41 g/mol. Its IUPAC name is bis(trifluoromethanesulfonate);1,2,4-trimethyl-1,4-diazoniabicyclo[2.2.2]octane.
| Compound Name | bis(trifluoromethanesulfonate);1,2,4-trimethyl-1,4-diazoniabicyclo[2.2.2]octane |
|---|---|
| PubChem CID | 86745454 |
| Molecular Formula | C11H20F6N2O6S2 |
| Molecular Weight | 454.41 g/mol |
| Exact Mass | 454.07 |
| IUPAC Name | bis(trifluoromethanesulfonate);1,2,4-trimethyl-1,4-diazoniabicyclo[2.2.2]octane |
| SMILES | CC1C[N+]2(C)CC[N+]1(C)CC2.O=S(=O)([O-])C(F)(F)F.O=S(=O)([O-])C(F)(F)F |
| InChI | InChI=1S/C9H20N2.2CHF3O3S/c1-9-8-10(2)4-6-11(9,3)7-5-10;2*2-1(3,4)8(5,6)7/h9H,4-8H2,1-3H3;2*(H,5,6,7)/q+2;;/p-2 |
| InChIKey | KBILIXPPKOWIBP-UHFFFAOYSA-L |
| XLogP | 0.40 |
| TPSA | 114.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.41 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|