C27H43FO5 — CID 86745714
methyl (5E)-5-[(3aS,4S,5R,6aS)-4-[(E)-4-fluoro-3-hydroxyoct-1-enyl]-5-(oxan-2-yloxy)-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-ylidene]pentanoate (PubChem CID 86745714) has the molecular formula C27H43FO5 and a molecular weight of 466.63 g/mol. Its IUPAC name is methyl (5E)-5-[(3aS,4S,5R,6aS)-4-[(E)-4-fluoro-3-hydroxyoct-1-enyl]-5-(oxan-2-yloxy)-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-ylidene]pentanoate.
| Compound Name | methyl (5E)-5-[(3aS,4S,5R,6aS)-4-[(E)-4-fluoro-3-hydroxyoct-1-enyl]-5-(oxan-2-yloxy)-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-ylidene]pentanoate |
|---|---|
| PubChem CID | 86745714 |
| Molecular Formula | C27H43FO5 |
| Molecular Weight | 466.63 g/mol |
| Exact Mass | 466.31 |
| IUPAC Name | methyl (5E)-5-[(3aS,4S,5R,6aS)-4-[(E)-4-fluoro-3-hydroxyoct-1-enyl]-5-(oxan-2-yloxy)-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-ylidene]pentanoate |
| SMILES | CCCCC(F)C(O)/C=C/[C@H]1[C@H]2C/C(=C/CCCC(=O)OC)C[C@H]2C[C@H]1OC1CCCCO1 |
| InChI | InChI=1S/C27H43FO5/c1-3-4-10-23(28)24(29)14-13-21-22-17-19(9-5-6-11-26(30)31-2)16-20(22)18-25(21)33-27-12-7-8-15-32-27/h9,13-14,20-25,27,29H,3-8,10-12,15-18H2,1-2H3/b14-13+,19-9+/t20-,21-,22-,23?,24?,25+,27?/m0/s1 |
| InChIKey | QCIGCPPXIZPANV-XNWJADAOSA-N |
| XLogP | 5.66 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.63 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|