dicyclopropylmethanimine;perchloric acid

C7H12ClNO4 — CID 86745742

IUPACdicyclopropylmethanimine;perchloric acid
SMILES[H]N=C(C1CC1)C1CC1.[O-][Cl+3]([O-])([O-])O
InChIInChI=1S/C7H11N.ClHO4/c8-7(5-1-2-5)6-3-4-6;2-1(3,4)5/h5-6,8H,1-4H2;(H,2,3,4,5)
InChIKeyFWIIYWGFVHVYGO-UHFFFAOYSA-N
MW209.63 g/mol
LogP-2.30
Rot. Bonds2

About dicyclopropylmethanimine;perchloric acid

dicyclopropylmethanimine;perchloric acid (PubChem CID 86745742) has the molecular formula C7H12ClNO4 and a molecular weight of 209.63 g/mol. Its IUPAC name is dicyclopropylmethanimine;perchloric acid.

Molecular Properties

Compound Namedicyclopropylmethanimine;perchloric acid
PubChem CID86745742
Molecular FormulaC7H12ClNO4
Molecular Weight209.63 g/mol
Exact Mass209.05
IUPAC Namedicyclopropylmethanimine;perchloric acid
SMILES[H]N=C(C1CC1)C1CC1.[O-][Cl+3]([O-])([O-])O
InChIInChI=1S/C7H11N.ClHO4/c8-7(5-1-2-5)6-3-4-6;2-1(3,4)5/h5-6,8H,1-4H2;(H,2,3,4,5)
InChIKeyFWIIYWGFVHVYGO-UHFFFAOYSA-N
XLogP-2.30
TPSA113.26 Ų
H-Bond Donors2
H-Bond Acceptors5
Rotatable Bonds2
Heavy Atoms13
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500209.63
LogP ≤ 5-2.30
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'imine_1', 'substructure': 'N/A'}

Analyze dicyclopropylmethanimine;perchloric acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of dicyclopropylmethanimine;perchloric acid?
The IUPAC name of dicyclopropylmethanimine;perchloric acid (CID 86745742) is dicyclopropylmethanimine;perchloric acid.
What is the SMILES notation for dicyclopropylmethanimine;perchloric acid?
The canonical SMILES for dicyclopropylmethanimine;perchloric acid is [H]N=C(C1CC1)C1CC1.[O-][Cl+3]([O-])([O-])O.
What is the InChIKey of dicyclopropylmethanimine;perchloric acid?
The InChIKey is FWIIYWGFVHVYGO-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11N.ClHO4/c8-7(5-1-2-5)6-3-4-6;2-1(3,4)5/h5-6,8H,1-4H2;(H,2,3,4,5).
What are the key properties of dicyclopropylmethanimine;perchloric acid?
dicyclopropylmethanimine;perchloric acid has a molecular weight of 209.63 g/mol, XLogP of -2.30, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for dicyclopropylmethanimine;perchloric acid is sourced from PubChem (CID 86745742), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).