C30H32BF4NO2 — CID 86745792
2-(1-ethoxy-2-phenylethylidene)-7,7-diphenyl-1,3,3a,5,6,7a-hexahydroisoindol-2-ium-4-one tetrafluoroborate (PubChem CID 86745792) has the molecular formula C30H32BF4NO2 and a molecular weight of 525.40 g/mol. Its IUPAC name is 2-(1-ethoxy-2-phenylethylidene)-7,7-diphenyl-1,3,3a,5,6,7a-hexahydroisoindol-2-ium-4-one tetrafluoroborate.
| Compound Name | 2-(1-ethoxy-2-phenylethylidene)-7,7-diphenyl-1,3,3a,5,6,7a-hexahydroisoindol-2-ium-4-one tetrafluoroborate |
|---|---|
| PubChem CID | 86745792 |
| Molecular Formula | C30H32BF4NO2 |
| Molecular Weight | 525.40 g/mol |
| Exact Mass | 525.25 |
| IUPAC Name | 2-(1-ethoxy-2-phenylethylidene)-7,7-diphenyl-1,3,3a,5,6,7a-hexahydroisoindol-2-ium-4-one tetrafluoroborate |
| SMILES | CCO/C(Cc1ccccc1)=[N+]1/CC2C(=O)CCC(c3ccccc3)(c3ccccc3)C2C1.F[B-](F)(F)F |
| InChI | InChI=1S/C30H32NO2.BF4/c1-2-33-29(20-23-12-6-3-7-13-23)31-21-26-27(22-31)30(19-18-28(26)32,24-14-8-4-9-15-24)25-16-10-5-11-17-25;2-1(3,4)5/h3-17,26-27H,2,18-22H2,1H3;/q+1;-1/b31-29-; |
| InChIKey | CZHAJABQQUDTDQ-QIXZSFSWSA-N |
| XLogP | 6.57 |
| TPSA | 29.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.40 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|