About prop-1-en-2-ylbenzene;urea
prop-1-en-2-ylbenzene;urea (PubChem CID 86745846) has the molecular formula C10H14N2O
and a molecular weight of 178.23 g/mol. Its IUPAC name is prop-1-en-2-ylbenzene;urea.
Molecular Properties
| Compound Name | prop-1-en-2-ylbenzene;urea |
| PubChem CID | 86745846 |
| Molecular Formula | C10H14N2O |
| Molecular Weight | 178.23 g/mol |
| Exact Mass | 178.11 |
| IUPAC Name | prop-1-en-2-ylbenzene;urea |
| SMILES | C=C(C)c1ccccc1.NC(N)=O |
| InChI | InChI=1S/C9H10.CH4N2O/c1-8(2)9-6-4-3-5-7-9;2-1(3)4/h3-7H,1H2,2H3;(H4,2,3,4) |
| InChIKey | YPDBYXLBDMJLHO-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 69.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.23 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze prop-1-en-2-ylbenzene;urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of prop-1-en-2-ylbenzene;urea?
The IUPAC name of prop-1-en-2-ylbenzene;urea (CID 86745846) is prop-1-en-2-ylbenzene;urea.
What is the SMILES notation for prop-1-en-2-ylbenzene;urea?
The canonical SMILES for prop-1-en-2-ylbenzene;urea is C=C(C)c1ccccc1.NC(N)=O.
What is the InChIKey of prop-1-en-2-ylbenzene;urea?
The InChIKey is YPDBYXLBDMJLHO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10.CH4N2O/c1-8(2)9-6-4-3-5-7-9;2-1(3)4/h3-7H,1H2,2H3;(H4,2,3,4).
What are the key properties of prop-1-en-2-ylbenzene;urea?
prop-1-en-2-ylbenzene;urea has a molecular weight of 178.23 g/mol, XLogP of 1.74, 1 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for prop-1-en-2-ylbenzene;urea is sourced from PubChem (CID 86745846), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).