C28H27N5O3 — CID 86746003
5-cyclohexyl-8-(2-hydroxyimino-2-phenylethyl)-11-phenyl-1,5,8,12-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),9,11-triene-2,6-dione (PubChem CID 86746003) has the molecular formula C28H27N5O3 and a molecular weight of 481.56 g/mol. Its IUPAC name is 5-cyclohexyl-8-(2-hydroxyimino-2-phenylethyl)-11-phenyl-1,5,8,12-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),9,11-triene-2,6-dione.
| Compound Name | 5-cyclohexyl-8-(2-hydroxyimino-2-phenylethyl)-11-phenyl-1,5,8,12-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),9,11-triene-2,6-dione |
|---|---|
| PubChem CID | 86746003 |
| Molecular Formula | C28H27N5O3 |
| Molecular Weight | 481.56 g/mol |
| Exact Mass | 481.21 |
| IUPAC Name | 5-cyclohexyl-8-(2-hydroxyimino-2-phenylethyl)-11-phenyl-1,5,8,12-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),9,11-triene-2,6-dione |
| SMILES | O=C1c2c(c(=O)n3nc(-c4ccccc4)cc3n2CC(=NO)c2ccccc2)CN1C1CCCCC1 |
| InChI | InChI=1S/C28H27N5O3/c34-27-22-17-31(21-14-8-3-9-15-21)28(35)26(22)32(18-24(30-36)20-12-6-2-7-13-20)25-16-23(29-33(25)27)19-10-4-1-5-11-19/h1-2,4-7,10-13,16,21,36H,3,8-9,14-15,17-18H2 |
| InChIKey | YMMPLAKWPCCWIQ-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 92.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.56 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|