C24H26N2O6S — CID 86746108
5-[[4-[(6-hydroxy-4-hydroxyimino-2,5,7,8-tetramethyl-3H-chromen-2-yl)methoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione (PubChem CID 86746108) has the molecular formula C24H26N2O6S and a molecular weight of 470.55 g/mol. Its IUPAC name is 5-[[4-[(6-hydroxy-4-hydroxyimino-2,5,7,8-tetramethyl-3H-chromen-2-yl)methoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione.
| Compound Name | 5-[[4-[(6-hydroxy-4-hydroxyimino-2,5,7,8-tetramethyl-3H-chromen-2-yl)methoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 86746108 |
| Molecular Formula | C24H26N2O6S |
| Molecular Weight | 470.55 g/mol |
| Exact Mass | 470.15 |
| IUPAC Name | 5-[[4-[(6-hydroxy-4-hydroxyimino-2,5,7,8-tetramethyl-3H-chromen-2-yl)methoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione |
| SMILES | Cc1c(C)c2c(c(C)c1O)C(=NO)CC(C)(COc1ccc(CC3SC(=O)NC3=O)cc1)O2 |
| InChI | InChI=1S/C24H26N2O6S/c1-12-13(2)21-19(14(3)20(12)27)17(26-30)10-24(4,32-21)11-31-16-7-5-15(6-8-16)9-18-22(28)25-23(29)33-18/h5-8,18,27,30H,9-11H2,1-4H3,(H,25,28,29) |
| InChIKey | NLIBGFMHOZCIMO-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 117.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.55 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|