About 4-methylbenzenesulfonic acid;[(2S,3S)-3-methyl-5-oxooxolan-2-yl]methyl 4-methylbenzenesulfonate
4-methylbenzenesulfonic acid;[(2S,3S)-3-methyl-5-oxooxolan-2-yl]methyl 4-methylbenzenesulfonate (PubChem CID 86746898) has the molecular formula C20H24O8S2
and a molecular weight of 456.54 g/mol. Its IUPAC name is 4-methylbenzenesulfonic acid;[(2S,3S)-3-methyl-5-oxooxolan-2-yl]methyl 4-methylbenzenesulfonate.
Molecular Properties
| Compound Name | 4-methylbenzenesulfonic acid;[(2S,3S)-3-methyl-5-oxooxolan-2-yl]methyl 4-methylbenzenesulfonate |
| PubChem CID | 86746898 |
| Molecular Formula | C20H24O8S2 |
| Molecular Weight | 456.54 g/mol |
| Exact Mass | 456.09 |
| IUPAC Name | 4-methylbenzenesulfonic acid;[(2S,3S)-3-methyl-5-oxooxolan-2-yl]methyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)O)cc1.Cc1ccc(S(=O)(=O)OC[C@H]2OC(=O)C[C@@H]2C)cc1 |
| InChI | InChI=1S/C13H16O5S.C7H8O3S/c1-9-3-5-11(6-4-9)19(15,16)17-8-12-10(2)7-13(14)18-12;1-6-2-4-7(5-3-6)11(8,9)10/h3-6,10,12H,7-8H2,1-2H3;2-5H,1H3,(H,8,9,10)/t10-,12+;/m0./s1 |
| InChIKey | UBCORNLYOMIQPX-XOZOLZJESA-N |
| XLogP | 2.89 |
| TPSA | 124.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 456.54 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 4-methylbenzenesulfonic acid;[(2S,3S)-3-methyl-5-oxooxolan-2-yl]methyl 4-methylbenzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methylbenzenesulfonic acid;[(2S,3S)-3-methyl-5-oxooxolan-2-yl]methyl 4-methylbenzenesulfonate?
The IUPAC name of 4-methylbenzenesulfonic acid;[(2S,3S)-3-methyl-5-oxooxolan-2-yl]methyl 4-methylbenzenesulfonate (CID 86746898) is 4-methylbenzenesulfonic acid;[(2S,3S)-3-methyl-5-oxooxolan-2-yl]methyl 4-methylbenzenesulfonate.
What is the SMILES notation for 4-methylbenzenesulfonic acid;[(2S,3S)-3-methyl-5-oxooxolan-2-yl]methyl 4-methylbenzenesulfonate?
The canonical SMILES for 4-methylbenzenesulfonic acid;[(2S,3S)-3-methyl-5-oxooxolan-2-yl]methyl 4-methylbenzenesulfonate is Cc1ccc(S(=O)(=O)O)cc1.Cc1ccc(S(=O)(=O)OC[C@H]2OC(=O)C[C@@H]2C)cc1.
What is the InChIKey of 4-methylbenzenesulfonic acid;[(2S,3S)-3-methyl-5-oxooxolan-2-yl]methyl 4-methylbenzenesulfonate?
The InChIKey is UBCORNLYOMIQPX-XOZOLZJESA-N. The full InChI is InChI=1S/C13H16O5S.C7H8O3S/c1-9-3-5-11(6-4-9)19(15,16)17-8-12-10(2)7-13(14)18-12;1-6-2-4-7(5-3-6)11(8,9)10/h3-6,10,12H,7-8H2,1-2H3;2-5H,1H3,(H,8,9,10)/t10-,12+;/m0./s1.
What are the key properties of 4-methylbenzenesulfonic acid;[(2S,3S)-3-methyl-5-oxooxolan-2-yl]methyl 4-methylbenzenesulfonate?
4-methylbenzenesulfonic acid;[(2S,3S)-3-methyl-5-oxooxolan-2-yl]methyl 4-methylbenzenesulfonate has a molecular weight of 456.54 g/mol, XLogP of 2.89, 5 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methylbenzenesulfonic acid;[(2S,3S)-3-methyl-5-oxooxolan-2-yl]methyl 4-methylbenzenesulfonate is sourced from PubChem (CID 86746898), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).