About (E)-3-[tert-butyl(dimethyl)silyl]prop-2-en-1-ol;methanesulfonate
(E)-3-[tert-butyl(dimethyl)silyl]prop-2-en-1-ol;methanesulfonate (PubChem CID 86747280) has the molecular formula C10H23O4SSi-
and a molecular weight of 267.44 g/mol. Its IUPAC name is (E)-3-[tert-butyl(dimethyl)silyl]prop-2-en-1-ol;methanesulfonate.
Molecular Properties
| Compound Name | (E)-3-[tert-butyl(dimethyl)silyl]prop-2-en-1-ol;methanesulfonate |
| PubChem CID | 86747280 |
| Molecular Formula | C10H23O4SSi- |
| Molecular Weight | 267.44 g/mol |
| Exact Mass | 267.11 |
| IUPAC Name | (E)-3-[tert-butyl(dimethyl)silyl]prop-2-en-1-ol;methanesulfonate |
| SMILES | CC(C)(C)[Si](C)(C)/C=C/CO.CS(=O)(=O)[O-] |
| InChI | InChI=1S/C9H20OSi.CH4O3S/c1-9(2,3)11(4,5)8-6-7-10;1-5(2,3)4/h6,8,10H,7H2,1-5H3;1H3,(H,2,3,4)/p-1/b8-6+; |
| InChIKey | VAUFNZONPSDMAX-WVLIHFOGSA-M |
| XLogP | 1.74 |
| TPSA | 77.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.44 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze (E)-3-[tert-butyl(dimethyl)silyl]prop-2-en-1-ol;methanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-3-[tert-butyl(dimethyl)silyl]prop-2-en-1-ol;methanesulfonate?
The IUPAC name of (E)-3-[tert-butyl(dimethyl)silyl]prop-2-en-1-ol;methanesulfonate (CID 86747280) is (E)-3-[tert-butyl(dimethyl)silyl]prop-2-en-1-ol;methanesulfonate.
What is the SMILES notation for (E)-3-[tert-butyl(dimethyl)silyl]prop-2-en-1-ol;methanesulfonate?
The canonical SMILES for (E)-3-[tert-butyl(dimethyl)silyl]prop-2-en-1-ol;methanesulfonate is CC(C)(C)[Si](C)(C)/C=C/CO.CS(=O)(=O)[O-].
What is the InChIKey of (E)-3-[tert-butyl(dimethyl)silyl]prop-2-en-1-ol;methanesulfonate?
The InChIKey is VAUFNZONPSDMAX-WVLIHFOGSA-M. The full InChI is InChI=1S/C9H20OSi.CH4O3S/c1-9(2,3)11(4,5)8-6-7-10;1-5(2,3)4/h6,8,10H,7H2,1-5H3;1H3,(H,2,3,4)/p-1/b8-6+;.
What are the key properties of (E)-3-[tert-butyl(dimethyl)silyl]prop-2-en-1-ol;methanesulfonate?
(E)-3-[tert-butyl(dimethyl)silyl]prop-2-en-1-ol;methanesulfonate has a molecular weight of 267.44 g/mol, XLogP of 1.74, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-3-[tert-butyl(dimethyl)silyl]prop-2-en-1-ol;methanesulfonate is sourced from PubChem (CID 86747280), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).