About 2-methylbenzenesulfonic acid;[4-(4-methylpent-3-enyl)cyclohex-3-en-1-yl]methanol
2-methylbenzenesulfonic acid;[4-(4-methylpent-3-enyl)cyclohex-3-en-1-yl]methanol (PubChem CID 86747414) has the molecular formula C20H30O4S
and a molecular weight of 366.52 g/mol. Its IUPAC name is 2-methylbenzenesulfonic acid;[4-(4-methylpent-3-enyl)cyclohex-3-en-1-yl]methanol.
Molecular Properties
| Compound Name | 2-methylbenzenesulfonic acid;[4-(4-methylpent-3-enyl)cyclohex-3-en-1-yl]methanol |
| PubChem CID | 86747414 |
| Molecular Formula | C20H30O4S |
| Molecular Weight | 366.52 g/mol |
| Exact Mass | 366.19 |
| IUPAC Name | 2-methylbenzenesulfonic acid;[4-(4-methylpent-3-enyl)cyclohex-3-en-1-yl]methanol |
| SMILES | CC(C)=CCCC1=CCC(CO)CC1.Cc1ccccc1S(=O)(=O)O |
| InChI | InChI=1S/C13H22O.C7H8O3S/c1-11(2)4-3-5-12-6-8-13(10-14)9-7-12;1-6-4-2-3-5-7(6)11(8,9)10/h4,6,13-14H,3,5,7-10H2,1-2H3;2-5H,1H3,(H,8,9,10) |
| InChIKey | VXPSXFDLYRHUTD-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 366.52 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 2-methylbenzenesulfonic acid;[4-(4-methylpent-3-enyl)cyclohex-3-en-1-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylbenzenesulfonic acid;[4-(4-methylpent-3-enyl)cyclohex-3-en-1-yl]methanol?
The IUPAC name of 2-methylbenzenesulfonic acid;[4-(4-methylpent-3-enyl)cyclohex-3-en-1-yl]methanol (CID 86747414) is 2-methylbenzenesulfonic acid;[4-(4-methylpent-3-enyl)cyclohex-3-en-1-yl]methanol.
What is the SMILES notation for 2-methylbenzenesulfonic acid;[4-(4-methylpent-3-enyl)cyclohex-3-en-1-yl]methanol?
The canonical SMILES for 2-methylbenzenesulfonic acid;[4-(4-methylpent-3-enyl)cyclohex-3-en-1-yl]methanol is CC(C)=CCCC1=CCC(CO)CC1.Cc1ccccc1S(=O)(=O)O.
What is the InChIKey of 2-methylbenzenesulfonic acid;[4-(4-methylpent-3-enyl)cyclohex-3-en-1-yl]methanol?
The InChIKey is VXPSXFDLYRHUTD-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22O.C7H8O3S/c1-11(2)4-3-5-12-6-8-13(10-14)9-7-12;1-6-4-2-3-5-7(6)11(8,9)10/h4,6,13-14H,3,5,7-10H2,1-2H3;2-5H,1H3,(H,8,9,10).
What are the key properties of 2-methylbenzenesulfonic acid;[4-(4-methylpent-3-enyl)cyclohex-3-en-1-yl]methanol?
2-methylbenzenesulfonic acid;[4-(4-methylpent-3-enyl)cyclohex-3-en-1-yl]methanol has a molecular weight of 366.52 g/mol, XLogP of 4.69, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylbenzenesulfonic acid;[4-(4-methylpent-3-enyl)cyclohex-3-en-1-yl]methanol is sourced from PubChem (CID 86747414), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).