C12F22O — CID 86747576
1,2,3,3,4,4,5,5,5-nonafluoro-1-(1,2,3,3,4,4,5,5,5-nonafluoropent-1-enoxy)pent-1-ene;1,1,2,2-tetrafluoroethene (PubChem CID 86747576) has the molecular formula C12F22O and a molecular weight of 578.09 g/mol. Its IUPAC name is 1,2,3,3,4,4,5,5,5-nonafluoro-1-(1,2,3,3,4,4,5,5,5-nonafluoropent-1-enoxy)pent-1-ene;1,1,2,2-tetrafluoroethene.
| Compound Name | 1,2,3,3,4,4,5,5,5-nonafluoro-1-(1,2,3,3,4,4,5,5,5-nonafluoropent-1-enoxy)pent-1-ene;1,1,2,2-tetrafluoroethene |
|---|---|
| PubChem CID | 86747576 |
| Molecular Formula | C12F22O |
| Molecular Weight | 578.09 g/mol |
| Exact Mass | 577.96 |
| IUPAC Name | 1,2,3,3,4,4,5,5,5-nonafluoro-1-(1,2,3,3,4,4,5,5,5-nonafluoropent-1-enoxy)pent-1-ene;1,1,2,2-tetrafluoroethene |
| SMILES | FC(F)=C(F)F.FC(OC(F)=C(F)C(F)(F)C(F)(F)C(F)(F)F)=C(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C10F18O.C2F4/c11-1(5(15,16)7(19,20)9(23,24)25)3(13)29-4(14)2(12)6(17,18)8(21,22)10(26,27)28;3-1(4)2(5)6 |
| InChIKey | DCSIADKYJYMWMM-UHFFFAOYSA-N |
| XLogP | 8.88 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.09 |
| LogP ≤ 5 | 8.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|