C19H21NO4S2 — CID 86748006
(NZ)-N-[7-[4-(2,2,4-trimethyl-1,3-dioxolan-4-yl)thiophen-2-yl]sulfanyl-2,3-dihydrochromen-4-ylidene]hydroxylamine (PubChem CID 86748006) has the molecular formula C19H21NO4S2 and a molecular weight of 391.51 g/mol. Its IUPAC name is (NZ)-N-[7-[4-(2,2,4-trimethyl-1,3-dioxolan-4-yl)thiophen-2-yl]sulfanyl-2,3-dihydrochromen-4-ylidene]hydroxylamine.
| Compound Name | (NZ)-N-[7-[4-(2,2,4-trimethyl-1,3-dioxolan-4-yl)thiophen-2-yl]sulfanyl-2,3-dihydrochromen-4-ylidene]hydroxylamine |
|---|---|
| PubChem CID | 86748006 |
| Molecular Formula | C19H21NO4S2 |
| Molecular Weight | 391.51 g/mol |
| Exact Mass | 391.09 |
| IUPAC Name | (NZ)-N-[7-[4-(2,2,4-trimethyl-1,3-dioxolan-4-yl)thiophen-2-yl]sulfanyl-2,3-dihydrochromen-4-ylidene]hydroxylamine |
| SMILES | CC1(C)OCC(C)(c2csc(Sc3ccc4c(c3)OCC/C4=N/O)c2)O1 |
| InChI | InChI=1S/C19H21NO4S2/c1-18(2)23-11-19(3,24-18)12-8-17(25-10-12)26-13-4-5-14-15(20-21)6-7-22-16(14)9-13/h4-5,8-10,21H,6-7,11H2,1-3H3/b20-15- |
| InChIKey | WVMMPVXEPIYZPV-HKWRFOASSA-N |
| XLogP | 4.86 |
| TPSA | 60.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.51 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|