C19H21F3N2O2S2 — CID 86748697
N-[1-[4-[5-[3-methoxy-1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]thiophen-2-yl]sulfanylphenyl]ethylidene]hydroxylamine (PubChem CID 86748697) has the molecular formula C19H21F3N2O2S2 and a molecular weight of 430.52 g/mol. Its IUPAC name is N-[1-[4-[5-[3-methoxy-1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]thiophen-2-yl]sulfanylphenyl]ethylidene]hydroxylamine.
| Compound Name | N-[1-[4-[5-[3-methoxy-1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]thiophen-2-yl]sulfanylphenyl]ethylidene]hydroxylamine |
|---|---|
| PubChem CID | 86748697 |
| Molecular Formula | C19H21F3N2O2S2 |
| Molecular Weight | 430.52 g/mol |
| Exact Mass | 430.10 |
| IUPAC Name | N-[1-[4-[5-[3-methoxy-1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]thiophen-2-yl]sulfanylphenyl]ethylidene]hydroxylamine |
| SMILES | COC1(c2ccc(Sc3ccc(C(C)=NO)cc3)s2)CCN(CC(F)(F)F)C1 |
| InChI | InChI=1S/C19H21F3N2O2S2/c1-13(23-25)14-3-5-15(6-4-14)27-17-8-7-16(28-17)18(26-2)9-10-24(11-18)12-19(20,21)22/h3-8,25H,9-12H2,1-2H3 |
| InChIKey | DBFYWYSXUPDPJN-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 45.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.52 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|