About butyl prop-2-enoate;methyl 2-methylprop-2-enoate;2-(2-methylprop-2-enoyloxy)ethyl 3-oxobutanoate
butyl prop-2-enoate;methyl 2-methylprop-2-enoate;2-(2-methylprop-2-enoyloxy)ethyl 3-oxobutanoate (PubChem CID 86748998) has the molecular formula C22H34O9
and a molecular weight of 442.51 g/mol. Its IUPAC name is butyl prop-2-enoate;methyl 2-methylprop-2-enoate;2-(2-methylprop-2-enoyloxy)ethyl 3-oxobutanoate.
Molecular Properties
| Compound Name | butyl prop-2-enoate;methyl 2-methylprop-2-enoate;2-(2-methylprop-2-enoyloxy)ethyl 3-oxobutanoate |
| PubChem CID | 86748998 |
| Molecular Formula | C22H34O9 |
| Molecular Weight | 442.51 g/mol |
| Exact Mass | 442.22 |
| IUPAC Name | butyl prop-2-enoate;methyl 2-methylprop-2-enoate;2-(2-methylprop-2-enoyloxy)ethyl 3-oxobutanoate |
| SMILES | C=C(C)C(=O)OC.C=C(C)C(=O)OCCOC(=O)CC(C)=O.C=CC(=O)OCCCC |
| InChI | InChI=1S/C10H14O5.C7H12O2.C5H8O2/c1-7(2)10(13)15-5-4-14-9(12)6-8(3)11;1-3-5-6-9-7(8)4-2;1-4(2)5(6)7-3/h1,4-6H2,2-3H3;4H,2-3,5-6H2,1H3;1H2,2-3H3 |
| InChIKey | TURDFUZELSAWIE-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 122.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 442.51 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze butyl prop-2-enoate;methyl 2-methylprop-2-enoate;2-(2-methylprop-2-enoyloxy)ethyl 3-oxobutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butyl prop-2-enoate;methyl 2-methylprop-2-enoate;2-(2-methylprop-2-enoyloxy)ethyl 3-oxobutanoate?
The IUPAC name of butyl prop-2-enoate;methyl 2-methylprop-2-enoate;2-(2-methylprop-2-enoyloxy)ethyl 3-oxobutanoate (CID 86748998) is butyl prop-2-enoate;methyl 2-methylprop-2-enoate;2-(2-methylprop-2-enoyloxy)ethyl 3-oxobutanoate.
What is the SMILES notation for butyl prop-2-enoate;methyl 2-methylprop-2-enoate;2-(2-methylprop-2-enoyloxy)ethyl 3-oxobutanoate?
The canonical SMILES for butyl prop-2-enoate;methyl 2-methylprop-2-enoate;2-(2-methylprop-2-enoyloxy)ethyl 3-oxobutanoate is C=C(C)C(=O)OC.C=C(C)C(=O)OCCOC(=O)CC(C)=O.C=CC(=O)OCCCC.
What is the InChIKey of butyl prop-2-enoate;methyl 2-methylprop-2-enoate;2-(2-methylprop-2-enoyloxy)ethyl 3-oxobutanoate?
The InChIKey is TURDFUZELSAWIE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14O5.C7H12O2.C5H8O2/c1-7(2)10(13)15-5-4-14-9(12)6-8(3)11;1-3-5-6-9-7(8)4-2;1-4(2)5(6)7-3/h1,4-6H2,2-3H3;4H,2-3,5-6H2,1H3;1H2,2-3H3.
What are the key properties of butyl prop-2-enoate;methyl 2-methylprop-2-enoate;2-(2-methylprop-2-enoyloxy)ethyl 3-oxobutanoate?
butyl prop-2-enoate;methyl 2-methylprop-2-enoate;2-(2-methylprop-2-enoyloxy)ethyl 3-oxobutanoate has a molecular weight of 442.51 g/mol, XLogP of 2.88, 11 rotatable bonds, 0 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for butyl prop-2-enoate;methyl 2-methylprop-2-enoate;2-(2-methylprop-2-enoyloxy)ethyl 3-oxobutanoate is sourced from PubChem (CID 86748998), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).