C20H17F6NO2 — CID 86749049
(5S,6S)-5-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-6-phenylpiperidin-2-one (PubChem CID 86749049) has the molecular formula C20H17F6NO2 and a molecular weight of 417.35 g/mol. Its IUPAC name is (5S,6S)-5-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-6-phenylpiperidin-2-one.
| Compound Name | (5S,6S)-5-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-6-phenylpiperidin-2-one |
|---|---|
| PubChem CID | 86749049 |
| Molecular Formula | C20H17F6NO2 |
| Molecular Weight | 417.35 g/mol |
| Exact Mass | 417.12 |
| IUPAC Name | (5S,6S)-5-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-6-phenylpiperidin-2-one |
| SMILES | O=C1CC[C@H](OCc2cc(C(F)(F)F)cc(C(F)(F)F)c2)C(c2ccccc2)N1 |
| InChI | InChI=1S/C20H17F6NO2/c21-19(22,23)14-8-12(9-15(10-14)20(24,25)26)11-29-16-6-7-17(28)27-18(16)13-4-2-1-3-5-13/h1-5,8-10,16,18H,6-7,11H2,(H,27,28)/t16-,18?/m0/s1 |
| InChIKey | STOIVPUMOZWZNS-ATNAJCNCSA-N |
| XLogP | 5.26 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.35 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |